messages
listlengths 3
3
|
|---|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a renin inhibitor.",
"role": "user"
},
{
"content": "COCCCn1cc(CN(C(=O)C2CN(C(=O)OC(C)(C)C)CCO2)C2CC2)c2ccc(C)nc21",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a renin inhibitor.",
"role": "user"
},
{
"content": "COCCCn1cc(CN(C(=O)C2CN(C(=O)OC(C)(C)C)CCO2)C2CC2)c2ccc(C)nc21",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a renin inhibitor.",
"role": "user"
},
{
"content": "COCCCn1cc(CN(C(=O)C2CN(C(=O)OC(C)(C)C)CCO2)C2CC2)c2ccc(C)nc21",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a renin inhibitor.",
"role": "user"
},
{
"content": "COCCCn1cc(CN(C(=O)C2CN(C(=O)OC(C)(C)C)CCO2)C2CC2)c2ccc(C)nc21",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a renin inhibitor.",
"role": "user"
},
{
"content": "COCCCn1cc(CN(C(=O)C2CN(C(=O)OC(C)(C)C)CCO2)C2CC2)c2ccc(C)nc21",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is a stabilizing mitochondrial structure that impacts barth syndrome. The molecule is a apoptosis, a cholesterol translocation, and a stabilizing cytochrome oxidase, and it impacts diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, tangier disease, and aging. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: It impacts non-alcoholic fatty liver disease, tangier disease, and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase that impacts both barth syndrome and aging. The molecule is a apoptosis, proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing mitochondrial structure. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, aging, diabetic heart disease, and barth syndrome. The molecule is a proton trap for oxidative phosphorylation, a cholesterol translocation, and a stabilizing mitochondrial structure, and it impacts tangier disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a stabilizing cytochrome oxidase that impacts both barth syndrome and tangier disease. The molecule is a cholesterol translocation that impacts both diabetic heart disease and aging. The molecule is a proton trap for oxidative phosphorylation, a apoptosis, and a stabilizing mitochondrial structure, and it impacts non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a cholesterol translocation that impacts aging. The molecule is a stabilizing mitochondrial structure, a proton trap for oxidative phosphorylation, and a stabilizing cytochrome oxidase, and it impacts tangier disease. The molecule is a apoptosis that impacts barth syndrome, diabetic heart disease, and non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is a inflammatory and belongs to the thyroxine treatment class of molecules, impacting both metabolic syndrome and atherosclerosis. The molecule is a energy storage and a membrane stabilizer, impacting both cardiovascular disease and pancreatitis. The molecule is a fat storage, nutrient, energy source that has an effect on cancer and impacts obesity. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCC(C)CC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a energy source, membrane stabilizer, energy storage that impacts atherosclerosis, obesity, and cardiovascular disease. The molecule is a fat storage, a nutrient, and a inflammatory that impacts both metabolic syndrome and pancreatitis, and is thyroxine treatment. It has an effect on cancer.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCC(C)CC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a fat storage, membrane stabilizer, inflammatory that has an effect on cancer and impacts pancreatitis. The molecule is a energy storage, energy source, thyroxine treatment, nutrient that impacts obesity. It impacts cardiovascular disease, atherosclerosis, and metabolic syndrome.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCC(C)CC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a membrane stabilizer, energy source, energy storage, fat storage that impacts atherosclerosis. The molecule is a inflammatory and a nutrient, which has an effect on cancer and impacts both metabolic syndrome and pancreatitis, while being thyroxine treatment. It impacts both cardiovascular disease and obesity.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCC(C)CC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a inflammatory and a energy storage that impacts metabolic syndrome, cancer, cardiovascular disease, and pancreatitis. The molecule is a energy source and membrane stabilizer, and it impacts atherosclerosis. The molecule is a fat storage and nutrient, belonging to the thyroxine treatment class of molecules, and impacts obesity.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCC(C)CC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): It impacts seizure, diabetes mellitus, cardiovascular disease, breast cancer, and stomach cancer. It impacts alzheimer's disease, parkinson's disease, and colorectal cancer.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O)OC(=O)C(N)CSC(C=CC=CC=CCC=CCCCCC)C(O)CCCC(=O)O",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: It impacts stomach cancer, colorectal cancer, breast cancer, cardiovascular disease, seizure, and diabetes mellitus. It impacts both alzheimer's disease and parkinson's disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O)OC(=O)C(N)CSC(C=CC=CC=CCC=CCCCCC)C(O)CCCC(=O)O",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: It impacts parkinson's disease, colorectal cancer, diabetes mellitus, and cardiovascular disease. It impacts breast cancer, stomach cancer, alzheimer's disease, and seizure.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O)OC(=O)C(N)CSC(C=CC=CC=CCC=CCCCCC)C(O)CCCC(=O)O",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: It has an effect on breast cancer, impacting both seizure and diabetes mellitus. It has an effect on colorectal cancer, and impacts cardiovascular disease, parkinson's disease, and stomach cancer. It impacts alzheimer's disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O)OC(=O)C(N)CSC(C=CC=CC=CCC=CCCCCC)C(O)CCCC(=O)O",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: It influences both stomach cancer and colorectal cancer, as well as affecting seizure and breast cancer. It impacts cardiovascular disease, diabetes mellitus, alzheimer's disease, and parkinson's disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O)OC(=O)C(N)CSC(C=CC=CC=CCC=CCCCCC)C(O)CCCC(=O)O",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a stabilizing cytochrome oxidase, a proton trap for oxidative phosphorylation, and a stabilizing mitochondrial structure, and it impacts barth syndrome. The molecule is a apoptosis and a cholesterol translocation that impacts diabetic heart disease, tangier disease, and aging. It impacts non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a cholesterol translocation and proton trap for oxidative phosphorylation, and it impacts diabetic heart disease. The molecule is a apoptosis that impacts both aging and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase, impacting both tangier disease and barth syndrome.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation, impacting both aging and barth syndrome. The molecule is a apoptosis, stabilizing mitochondrial structure, cholesterol translocation that impacts tangier disease, non-alcoholic fatty liver disease, and diabetic heart disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is a stabilizing mitochondrial structure and a cholesterol translocation, impacting both diabetic heart disease and aging. The molecule is a proton trap for oxidative phosphorylation and a apoptosis, impacting both tangier disease and barth syndrome. The molecule is a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a proton trap for oxidative phosphorylation and a apoptosis, impacting both diabetic heart disease and tangier disease. The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, cholesterol translocation that impacts aging, barth syndrome, and non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: It impacts cardiovascular disease, breast cancer, and seizure. It has an effect on stomach cancer, and impacts diabetes mellitus, colorectal cancer, and parkinson's disease. It impacts alzheimer's disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC1COP(=O)(O)OC2C(O)C(O)C(O)C(CC=CCCCC(=O)O1)C(O)CC(O)C(C=CC(O)CCCCC)C(O)C2O",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: It has an effect on stomach cancer, and impacts breast cancer, seizure, and cardiovascular disease. It impacts alzheimer's disease, colorectal cancer, diabetes mellitus, and parkinson's disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC1COP(=O)(O)OC2C(O)C(O)C(O)C(CC=CCCCC(=O)O1)C(O)CC(O)C(C=CC(O)CCCCC)C(O)C2O",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: It impacts colorectal cancer. It impacts stomach cancer, seizure, and breast cancer. It impacts parkinson's disease, diabetes mellitus, alzheimer's disease, and cardiovascular disease. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC1COP(=O)(O)OC2C(O)C(O)C(O)C(CC=CCCCC(=O)O1)C(O)CC(O)C(C=CC(O)CCCCC)C(O)C2O",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: It impacts colorectal cancer. It impacts diabetes mellitus, parkinson's disease, and stomach cancer. It impacts breast cancer, cardiovascular disease, seizure, and alzheimer's disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC1COP(=O)(O)OC2C(O)C(O)C(O)C(CC=CCCCC(=O)O1)C(O)CC(O)C(C=CC(O)CCCCC)C(O)C2O",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "It impacts stomach cancer, seizure, and parkinson's disease. It influences both colorectal cancer and breast cancer, as well as affecting alzheimer's disease and cardiovascular disease. It impacts diabetes mellitus. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC1COP(=O)(O)OC2C(O)C(O)C(O)C(CC=CCCCC(=O)O1)C(O)CC(O)C(C=CC(O)CCCCC)C(O)C2O",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a cancer treatment.",
"role": "user"
},
{
"content": "Cc1cccc(C(C)Nc2nnc(C)c3ccc(N4CCOCC4)cc23)c1Cl",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: It belongs to the cancer treatment class of molecules.",
"role": "user"
},
{
"content": "Cc1cccc(C(C)Nc2nnc(C)c3ccc(N4CCOCC4)cc23)c1Cl",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? It impacts cancer treatment.",
"role": "user"
},
{
"content": "Cc1cccc(C(C)Nc2nnc(C)c3ccc(N4CCOCC4)cc23)c1Cl",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: It belongs to the cancer treatment class of molecules. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "Cc1cccc(C(C)Nc2nnc(C)c3ccc(N4CCOCC4)cc23)c1Cl",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: It impacts cancer treatment.",
"role": "user"
},
{
"content": "Cc1cccc(C(C)Nc2nnc(C)c3ccc(N4CCOCC4)cc23)c1Cl",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: It impacts non-alcoholic fatty liver disease, diabetic heart disease, and aging. The molecule is a proton trap for oxidative phosphorylation, a cholesterol translocation, and a stabilizing mitochondrial structure, and it impacts barth syndrome. The molecule is a apoptosis and stabilizing cytochrome oxidase, and it impacts tangier disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts barth syndrome, non-alcoholic fatty liver disease, and tangier disease. The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, cholesterol translocation that impacts diabetic heart disease and aging.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase, impacting both non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a cholesterol translocation that impacts tangier disease, barth syndrome, and aging. The molecule is both a apoptosis and a proton trap for oxidative phosphorylation.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a stabilizing mitochondrial structure that impacts tangier disease, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is a apoptosis, cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts barth syndrome and aging.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a apoptosis and a cholesterol translocation that impacts tangier disease, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts aging and diabetic heart disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a cholesterol translocation that impacts non-alcoholic fatty liver disease, aging, and diabetic heart disease. The molecule is a stabilizing mitochondrial structure, a apoptosis, and a stabilizing cytochrome oxidase, and it impacts barth syndrome. The molecule is a proton trap for oxidative phosphorylation that impacts tangier disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): It impacts tangier disease, aging, and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase and cholesterol translocation, and it impacts barth syndrome. The molecule is a proton trap for oxidative phosphorylation, a apoptosis, and a stabilizing mitochondrial structure, and it impacts diabetic heart disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation, impacting both non-alcoholic fatty liver disease and tangier disease. The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase, impacting both barth syndrome and aging. The molecule is a apoptosis that impacts diabetic heart disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a stabilizing mitochondrial structure, a cholesterol translocation, and a proton trap for oxidative phosphorylation, and it impacts tangier disease. The molecule is a stabilizing cytochrome oxidase and a apoptosis, impacting both non-alcoholic fatty liver disease and aging. It impacts both diabetic heart disease and barth syndrome.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a stabilizing cytochrome oxidase, a apoptosis, and a proton trap for oxidative phosphorylation. It impacts aging, non-alcoholic fatty liver disease, barth syndrome, and diabetic heart disease. The molecule is a cholesterol translocation and stabilizing mitochondrial structure, and it impacts tangier disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a stabilizing cytochrome oxidase, apoptosis, cholesterol translocation that impacts aging and diabetic heart disease. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts tangier disease, barth syndrome, and non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a apoptosis, stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a cholesterol translocation that impacts barth syndrome, tangier disease, and aging.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: It impacts tangier disease. The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation, impacting both diabetic heart disease and aging. The molecule is a apoptosis, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and barth syndrome.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is a cholesterol translocation, a stabilizing mitochondrial structure, and a stabilizing cytochrome oxidase, and it impacts barth syndrome. The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts diabetic heart disease, tangier disease, and non-alcoholic fatty liver disease. It impacts aging. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a stabilizing cytochrome oxidase and a apoptosis, impacting both non-alcoholic fatty liver disease and tangier disease. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation, impacting both barth syndrome and diabetic heart disease. The molecule is a cholesterol translocation that impacts aging.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a apoptosis and a stabilizing mitochondrial structure, impacting both aging and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase, impacting both diabetic heart disease and tangier disease. The molecule is a cholesterol translocation that impacts barth syndrome.",
"role": "user"
},
{
"content": "CCCCCC=CCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a apoptosis and a cholesterol translocation, impacting both aging and tangier disease. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease, diabetic heart disease, and barth syndrome. The molecule is a stabilizing mitochondrial structure.",
"role": "user"
},
{
"content": "CCCCCC=CCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: It impacts tangier disease. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation, impacting both diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a apoptosis, cholesterol translocation, stabilizing cytochrome oxidase that impacts aging and barth syndrome.",
"role": "user"
},
{
"content": "CCCCCC=CCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a cholesterol translocation and a apoptosis, impacting both tangier disease and barth syndrome. The molecule is a stabilizing mitochondrial structure that impacts aging, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is both a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CCCCCC=CCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a stabilizing cytochrome oxidase, a apoptosis, and a stabilizing mitochondrial structure, and it impacts non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts diabetic heart disease, tangier disease, and aging. It impacts barth syndrome.",
"role": "user"
},
{
"content": "CCCCCC=CCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule has Odorless. The molecule has Bitter, metallic taste. When heated to decomposition ... emits toxic fumes of nitrogen oxides.",
"role": "user"
},
{
"content": "O=[N+]([O-])[O-].[Ag+]",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule has Odorless. The molecule has Bitter, metallic taste. When heated to decomposition ... emits toxic fumes of nitrogen oxides.",
"role": "user"
},
{
"content": "O=[N+]([O-])[O-].[Ag+]",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: When heated to decomposition ... emits toxic fumes of nitrogen oxides. The molecule has both a Odorless and a Bitter, metallic taste.",
"role": "user"
},
{
"content": "O=[N+]([O-])[O-].[Ag+]",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? When heated to decomposition ... emits toxic fumes of nitrogen oxides. The molecule has both a Bitter, metallic taste and a Odorless.",
"role": "user"
},
{
"content": "O=[N+]([O-])[O-].[Ag+]",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: When heated to decomposition ... emits toxic fumes of nitrogen oxides. The molecule has both a Bitter, metallic taste and a Odorless.",
"role": "user"
},
{
"content": "O=[N+]([O-])[O-].[Ag+]",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation, impacting both diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure that impacts barth syndrome, aging, and tangier disease. The molecule is both a cholesterol translocation and a apoptosis.",
"role": "user"
},
{
"content": "CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: It impacts diabetic heart disease. The molecule is a cholesterol translocation and a apoptosis, impacting both aging and tangier disease. The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and barth syndrome.",
"role": "user"
},
{
"content": "CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a stabilizing cytochrome oxidase, a cholesterol translocation, and a apoptosis, and it impacts diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts tangier disease, aging, and barth syndrome. It impacts non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is a stabilizing cytochrome oxidase and a apoptosis, impacting both non-alcoholic fatty liver disease and barth syndrome. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts tangier disease, diabetic heart disease, and aging. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation, apoptosis. The molecule is a proton trap for oxidative phosphorylation that impacts tangier disease, aging, barth syndrome, and non-alcoholic fatty liver disease. It impacts diabetic heart disease.",
"role": "user"
},
{
"content": "CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure, impacting both non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a cholesterol translocation that impacts barth syndrome, aging, and tangier disease. The molecule is both a apoptosis and a stabilizing cytochrome oxidase.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a apoptosis that impacts tangier disease, aging, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts diabetic heart disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a proton trap for oxidative phosphorylation, apoptosis, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts tangier disease and diabetic heart disease. The molecule is a cholesterol translocation that impacts barth syndrome, non-alcoholic fatty liver disease, and aging.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a apoptosis. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure, impacting both non-alcoholic fatty liver disease and aging. The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts tangier disease, diabetic heart disease, and barth syndrome.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, apoptosis, cholesterol translocation that impacts aging and barth syndrome. The molecule is a stabilizing cytochrome oxidase that impacts diabetic heart disease, non-alcoholic fatty liver disease, and tangier disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, apoptosis that impacts diabetic heart disease, non-alcoholic fatty liver disease, and tangier disease. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase, impacting both barth syndrome and aging.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: It impacts aging, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure, impacting both tangier disease and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase, a proton trap for oxidative phosphorylation, and a apoptosis.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a stabilizing mitochondrial structure that impacts both aging and barth syndrome. The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation, impacting both non-alcoholic fatty liver disease and tangier disease. The molecule is a apoptosis and stabilizing cytochrome oxidase, and it impacts diabetic heart disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is a stabilizing cytochrome oxidase. The molecule is a proton trap for oxidative phosphorylation, a cholesterol translocation, and a stabilizing mitochondrial structure, and it impacts barth syndrome. The molecule is a apoptosis that impacts non-alcoholic fatty liver disease, diabetic heart disease, aging, and tangier disease. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation, impacting both barth syndrome and diabetic heart disease. The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts non-alcoholic fatty liver disease, aging, and tangier disease. The molecule is a proton trap for oxidative phosphorylation.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a nutrient that affects cervical cancer by impacting breast cancer, atherosclerosis, and ulcerative colitis.",
"role": "user"
},
{
"content": "CCCCCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCCCCCC=CCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a nutrient that impacts both breast cancer and atherosclerosis. It impacts both cervical cancer and ulcerative colitis.",
"role": "user"
},
{
"content": "CCCCCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCCCCCC=CCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a nutrient that affects cervical cancer by impacting atherosclerosis, breast cancer, and ulcerative colitis. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CCCCCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCCCCCC=CCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is a nutrient that affects both cervical cancer and breast cancer, and also impacts ulcerative colitis and atherosclerosis. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "CCCCCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCCCCCC=CCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is a nutrient that impacts breast cancer, cervical cancer, ulcerative colitis, and atherosclerosis. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CCCCCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCCCCCC=CCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts tangier disease, barth syndrome, and aging. The molecule is a apoptosis, cholesterol translocation, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and diabetic heart disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, tangier disease, aging, and barth syndrome. The molecule is a proton trap for oxidative phosphorylation, a apoptosis, and a cholesterol translocation, and it impacts diabetic heart disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a stabilizing mitochondrial structure and apoptosis, and it impacts barth syndrome. The molecule is a stabilizing cytochrome oxidase that impacts both non-alcoholic fatty liver disease and aging. The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation, impacting both diabetic heart disease and tangier disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a proton trap for oxidative phosphorylation, a apoptosis, and a cholesterol translocation, and it impacts diabetic heart disease. The molecule is a stabilizing mitochondrial structure that impacts aging, non-alcoholic fatty liver disease, tangier disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a apoptosis, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure that impacts barth syndrome, diabetic heart disease, and aging.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule has both a Odorless or almost odorless and a Slightly bitter taste. When heated to decomposition it emits toxic fumes of nitroxides.",
"role": "user"
},
{
"content": "CC(C)=CCN1CCC2(C)c3cc(O)ccc3CC1C2C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule has Odorless or almost odorless. When heated to decomposition it emits toxic fumes of nitroxides. The molecule has Slightly bitter taste.",
"role": "user"
},
{
"content": "CC(C)=CCN1CCC2(C)c3cc(O)ccc3CC1C2C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule has Slightly bitter taste. The molecule has Odorless or almost odorless. When heated to decomposition it emits toxic fumes of nitroxides.",
"role": "user"
},
{
"content": "CC(C)=CCN1CCC2(C)c3cc(O)ccc3CC1C2C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule has Odorless or almost odorless. The molecule has Slightly bitter taste. When heated to decomposition it emits toxic fumes of nitroxides.",
"role": "user"
},
{
"content": "CC(C)=CCN1CCC2(C)c3cc(O)ccc3CC1C2C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: When heated to decomposition it emits toxic fumes of nitroxides. The molecule has both a Slightly bitter taste and a Odorless or almost odorless.",
"role": "user"
},
{
"content": "CC(C)=CCN1CCC2(C)c3cc(O)ccc3CC1C2C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a nutrient. The molecule is a fat storage and thyroxine treatment, impacting cardiovascular disease, metabolic syndrome, pancreatitis, and atherosclerosis.",
"role": "user"
},
{
"content": "CCCCCCCCC=CCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OCCCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a fat storage. The molecule is a nutrient and a thyroxine treatment that impacts pancreatitis, metabolic syndrome, cardiovascular disease, and atherosclerosis.",
"role": "user"
},
{
"content": "CCCCCCCCC=CCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OCCCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a nutrient and fat storage, and it impacts metabolic syndrome. The molecule is a member of the thyroxine treatment class and affects pancreatitis, cardiovascular disease, and atherosclerosis.",
"role": "user"
},
{
"content": "CCCCCCCCC=CCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OCCCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is a thyroxine treatment that impacts both cardiovascular disease and metabolic syndrome. The molecule is a fat storage and a nutrient, impacting both pancreatitis and atherosclerosis. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CCCCCCCCC=CCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OCCCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a nutrient that impacts both atherosclerosis and cardiovascular disease. The molecule is a fat storage that impacts pancreatitis, thyroxine treatment, and metabolic syndrome. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CCCCCCCCC=CCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OCCCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is both a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure. The molecule is a cholesterol translocation that impacts aging, barth syndrome, and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and a apoptosis, impacting both non-alcoholic fatty liver disease and tangier disease. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a proton trap for oxidative phosphorylation that impacts tangier disease, non-alcoholic fatty liver disease, aging, and barth syndrome. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure, apoptosis that impacts diabetic heart disease. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, apoptosis that impacts barth syndrome and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts diabetic heart disease, aging, and tangier disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: It impacts non-alcoholic fatty liver disease. The molecule is a apoptosis, a stabilizing mitochondrial structure, and a stabilizing cytochrome oxidase, and it impacts diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts tangier disease, aging, and barth syndrome.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a apoptosis, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging. The molecule is a stabilizing mitochondrial structure and a cholesterol translocation, impacting both tangier disease and barth syndrome.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |