messages
listlengths
3
3
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "It belongs to the tumor treatment class of molecules. Use the above information to create a molecule.", "role": "user" }, { "content": "Cc1cccc2c(OC(=O)N(CCOCCO)CCN(C)C(=O)OCc3ccc(NC(=O)CNC(=O)C(NC(=O)OCN4C(=O)C=CC4=O)C(C)C)cc3)cc3c(c12)CCN3C(=O)c1cc2cc(NC(=O)c3ccc(O)cc3)cnc2[nH]1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: It belongs to the tumor treatment class of molecules.", "role": "user" }, { "content": "Cc1cccc2c(OC(=O)N(CCOCCO)CCN(C)C(=O)OCc3ccc(NC(=O)CNC(=O)C(NC(=O)OCN4C(=O)C=CC4=O)C(C)C)cc3)cc3c(c12)CCN3C(=O)c1cc2cc(NC(=O)c3ccc(O)cc3)cnc2[nH]1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Build a molecule that meets the requirement: The molecule is a tumor treatment.", "role": "user" }, { "content": "Cc1cccc2c(OC(=O)N(CCOCCO)CCN(C)C(=O)OCc3ccc(NC(=O)CNC(=O)C(NC(=O)OCN4C(=O)C=CC4=O)C(C)C)cc3)cc3c(c12)CCN3C(=O)c1cc2cc(NC(=O)c3ccc(O)cc3)cnc2[nH]1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Based on the given information, generate a molecule that meets the desired specifications: It impacts tumor treatment.", "role": "user" }, { "content": "Cc1cccc2c(OC(=O)N(CCOCCO)CCN(C)C(=O)OCc3ccc(NC(=O)CNC(=O)C(NC(=O)OCN4C(=O)C=CC4=O)C(C)C)cc3)cc3c(c12)CCN3C(=O)c1cc2cc(NC(=O)c3ccc(O)cc3)cnc2[nH]1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a tumor treatment.", "role": "user" }, { "content": "Cc1cccc2c(OC(=O)N(CCOCCO)CCN(C)C(=O)OCc3ccc(NC(=O)CNC(=O)C(NC(=O)OCN4C(=O)C=CC4=O)C(C)C)cc3)cc3c(c12)CCN3C(=O)c1cc2cc(NC(=O)c3ccc(O)cc3)cnc2[nH]1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is both a protease inhibitor and a anti viral.", "role": "user" }, { "content": "CN(C(=O)c1cc2c(F)cccc2[nH]1)C(CC1CC1)C(=O)N1CC2(CC1C#N)C(=O)Nc1ccccc12", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is both a anti viral and a protease inhibitor.", "role": "user" }, { "content": "CN(C(=O)c1cc2c(F)cccc2[nH]1)C(CC1CC1)C(=O)N1CC2(CC1C#N)C(=O)Nc1ccccc12", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Can you create a molecule that matches the given characteristics? The molecule is a protease inhibitor and belongs to the anti viral class of molecules.", "role": "user" }, { "content": "CN(C(=O)c1cc2c(F)cccc2[nH]1)C(CC1CC1)C(=O)N1CC2(CC1C#N)C(=O)Nc1ccccc12", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a protease inhibitor and belongs to the anti viral class of molecules.", "role": "user" }, { "content": "CN(C(=O)c1cc2c(F)cccc2[nH]1)C(CC1CC1)C(=O)N1CC2(CC1C#N)C(=O)Nc1ccccc12", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Suppose there is a molecule that meets the following description: The molecule is a protease inhibitor and belongs to the anti viral class of molecules. Please write the SMILES representation of it.", "role": "user" }, { "content": "CN(C(=O)c1cc2c(F)cccc2[nH]1)C(CC1CC1)C(=O)N1CC2(CC1C#N)C(=O)Nc1ccccc12", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? The molecule is a mcl1 inhibitor that impacts cancer treatment.", "role": "user" }, { "content": "Cc1cc(OCCCc2c(C(=O)NCc3ccnc(Cl)c3)[nH]c3c(-c4c(C)nn(C)c4C)cccc23)cc(C)c1Cl", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I need a molecule that meets the following conditions: The molecule is a mcl1 inhibitor and belongs to the cancer treatment class of molecules. Please represent the molecule in SMILES.", "role": "user" }, { "content": "Cc1cc(OCCCc2c(C(=O)NCc3ccnc(Cl)c3)[nH]c3c(-c4c(C)nn(C)c4C)cccc23)cc(C)c1Cl", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Can you create a molecule that matches the given characteristics? The molecule is a mcl1 inhibitor and is cancer treatment.", "role": "user" }, { "content": "Cc1cc(OCCCc2c(C(=O)NCc3ccnc(Cl)c3)[nH]c3c(-c4c(C)nn(C)c4C)cccc23)cc(C)c1Cl", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is both a mcl1 inhibitor and a cancer treatment.", "role": "user" }, { "content": "Cc1cc(OCCCc2c(C(=O)NCc3ccnc(Cl)c3)[nH]c3c(-c4c(C)nn(C)c4C)cccc23)cc(C)c1Cl", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? The molecule is a mcl1 inhibitor that impacts cancer treatment.", "role": "user" }, { "content": "Cc1cc(OCCCc2c(C(=O)NCc3ccnc(Cl)c3)[nH]c3c(-c4c(C)nn(C)c4C)cccc23)cc(C)c1Cl", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule that fulfills the requirement: The molecule is both a cancer treatment and a histone demethylase inhibitor.", "role": "user" }, { "content": "FC(F)(F)c1n[nH]nc1-c1ccnc(-c2cn(CC3CCc4cc(C5CC5)ccc43)cn2)c1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is both a histone demethylase inhibitor and a cancer treatment.", "role": "user" }, { "content": "FC(F)(F)c1n[nH]nc1-c1ccnc(-c2cn(CC3CCc4cc(C5CC5)ccc43)cn2)c1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a histone demethylase inhibitor that impacts cancer treatment.", "role": "user" }, { "content": "FC(F)(F)c1n[nH]nc1-c1ccnc(-c2cn(CC3CCc4cc(C5CC5)ccc43)cn2)c1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "The molecule is both a histone demethylase inhibitor and a cancer treatment. Use the above information to create a molecule.", "role": "user" }, { "content": "FC(F)(F)c1n[nH]nc1-c1ccnc(-c2cn(CC3CCc4cc(C5CC5)ccc43)cn2)c1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule based on this description: The molecule is a histone demethylase inhibitor and is cancer treatment.", "role": "user" }, { "content": "FC(F)(F)c1n[nH]nc1-c1ccnc(-c2cn(CC3CCc4cc(C5CC5)ccc43)cn2)c1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, tangier disease, and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation, apoptosis, stabilizing mitochondrial structure that impacts aging and barth syndrome.", "role": "user" }, { "content": "CCCCCCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Come up with a molecule based on the description: The molecule is a stabilizing mitochondrial structure, apoptosis, proton trap for oxidative phosphorylation that impacts aging and tangier disease. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts non-alcoholic fatty liver disease, barth syndrome, and diabetic heart disease.", "role": "user" }, { "content": "CCCCCCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a stabilizing cytochrome oxidase that impacts tangier disease. The molecule is a apoptosis that impacts barth syndrome, aging, and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation, a proton trap for oxidative phosphorylation, and a stabilizing mitochondrial structure, and it impacts diabetic heart disease.", "role": "user" }, { "content": "CCCCCCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule that fulfills the requirement: The molecule is a apoptosis, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts tangier disease and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts diabetic heart disease, aging, and barth syndrome.", "role": "user" }, { "content": "CCCCCCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a proton trap for oxidative phosphorylation and a apoptosis, impacting both non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts tangier disease, barth syndrome, and aging.", "role": "user" }, { "content": "CCCCCCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Suppose there is a molecule that meets the following description: The molecule is a membrane stabilizer and a nutrient, impacting both obesity and metabolic syndrome. The molecule is a energy source and a fat storage that impacts cancer, thyroxine treatment, and atherosclerosis. The molecule is a energy storage and a inflammatory, impacting both cardiovascular disease and pancreatitis. Please write the SMILES representation of it.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a inflammatory, membrane stabilizer, energy source that impacts cardiovascular disease and obesity. The molecule is a nutrient that affects cancer by impacting both pancreatitis and atherosclerosis. The molecule is a fat storage and a energy storage, it impacts metabolic syndrome, and is thyroxine treatment.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Build a molecule that meets the requirement: The molecule is a membrane stabilizer that impacts both cardiovascular disease and pancreatitis. The molecule is a fat storage and a inflammatory, it impacts cancer, and is thyroxine treatment. The molecule is a energy storage, nutrient, energy source that impacts obesity, atherosclerosis, and metabolic syndrome.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a energy source that belongs to the thyroxine treatment class of molecules, impacting cardiovascular disease, metabolic syndrome, and atherosclerosis. The molecule is a nutrient, energy storage, fat storage, inflammatory, membrane stabilizer that impacts obesity. It impacts both pancreatitis and cancer.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a nutrient and is part of the thyroxine treatment class, affecting cardiovascular disease, metabolic syndrome, atherosclerosis, and pancreatitis. The molecule is a inflammatory, membrane stabilizer, energy source, energy storage that impacts obesity and cancer. The molecule is a fat storage.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "The molecule is a nutrient. Use the above information to create a molecule.", "role": "user" }, { "content": "CCC=CCC=CCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCC=CCC=CCC=CCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I need a molecule that meets the following conditions: The molecule is a nutrient. Please represent the molecule in SMILES.", "role": "user" }, { "content": "CCC=CCC=CCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCC=CCC=CCC=CCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule based on this description: The molecule is a nutrient.", "role": "user" }, { "content": "CCC=CCC=CCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCC=CCC=CCC=CCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Build a molecule that meets the requirement: The molecule is a nutrient.", "role": "user" }, { "content": "CCC=CCC=CCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCC=CCC=CCC=CCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Come up with a molecule based on the description: The molecule is a nutrient.", "role": "user" }, { "content": "CCC=CCC=CCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCC=CCC=CCC=CCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I need a molecule that meets the following conditions: The molecule is a energy source and nutrient, and it impacts obesity. The molecule is a fat storage and a thyroxine treatment, with effects on cancer and impacts on pancreatitis. The molecule is a membrane stabilizer, energy storage, inflammatory that impacts atherosclerosis, metabolic syndrome, and cardiovascular disease. Please represent the molecule in SMILES.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule that fulfills the requirement: It impacts atherosclerosis, pancreatitis, obesity, thyroxine treatment, and cardiovascular disease. The molecule is a energy storage, nutrient, fat storage, energy source, inflammatory with an effect on cancer. The molecule is a membrane stabilizer that impacts metabolic syndrome.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I need a molecule that meets the following conditions: The molecule is a energy source, membrane stabilizer, fat storage with an effect on cancer. The molecule is a energy storage and nutrient, belonging to the thyroxine treatment class of molecules, and it impacts both metabolic syndrome and cardiovascular disease. The molecule is a inflammatory that impacts pancreatitis, obesity, and atherosclerosis. Please represent the molecule in SMILES.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Come up with a molecule based on the description: The molecule is a energy source, nutrient, membrane stabilizer that has an effect on cancer and impacts atherosclerosis. The molecule is a fat storage and a energy storage that impacts metabolic syndrome, obesity, and pancreatitis. The molecule is a inflammatory and belongs to the thyroxine treatment class of molecules, impacting cardiovascular disease.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a fat storage and a energy source that impacts pancreatitis, atherosclerosis, cardiovascular disease, and obesity. The molecule is a membrane stabilizer, inflammatory, nutrient, energy storage that impacts cancer and thyroxine treatment. It impacts metabolic syndrome.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I need a molecule that meets the following conditions: The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts aging, tangier disease, and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase, apoptosis, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and barth syndrome. Please represent the molecule in SMILES.", "role": "user" }, { "content": "CCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I need a molecule that meets the following conditions: The molecule is a apoptosis and a cholesterol translocation, impacting both non-alcoholic fatty liver disease and aging. The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts diabetic heart disease, tangier disease, and barth syndrome. Please represent the molecule in SMILES.", "role": "user" }, { "content": "CCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a proton trap for oxidative phosphorylation, apoptosis, cholesterol translocation that impacts non-alcoholic fatty liver disease and barth syndrome. The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts diabetic heart disease, aging, and tangier disease.", "role": "user" }, { "content": "CCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation, impacting both tangier disease and barth syndrome. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, apoptosis that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging.", "role": "user" }, { "content": "CCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I need a molecule that meets the following conditions: The molecule is a stabilizing mitochondrial structure and a apoptosis, impacting both diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation, impacting both barth syndrome and aging. The molecule is a proton trap for oxidative phosphorylation that impacts tangier disease. Please represent the molecule in SMILES.", "role": "user" }, { "content": "CCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? The molecule is a nutrient and a thyroxine treatment, impacting both metabolic syndrome and atherosclerosis. The molecule is a fat storage that impacts both cardiovascular disease and pancreatitis.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Suppose there is a molecule that meets the following description: The molecule is a nutrient and a fat storage that impacts atherosclerosis, pancreatitis, and thyroxine treatment. It impacts both cardiovascular disease and metabolic syndrome. Please write the SMILES representation of it.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Come up with a molecule based on the description: The molecule is a nutrient and thyroxine treatment, and it impacts atherosclerosis. The molecule is a fat storage that impacts pancreatitis, cardiovascular disease, and metabolic syndrome.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Build a molecule that meets the requirement: The molecule is a nutrient and a fat storage that impacts pancreatitis, atherosclerosis, and metabolic syndrome. The molecule is a member of the thyroxine treatment class and affects cardiovascular disease.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule that fulfills the requirement: The molecule is a nutrient that impacts both pancreatitis and cardiovascular disease. The molecule is a fat storage and thyroxine treatment, impacting both atherosclerosis and metabolic syndrome.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule based on this description: The molecule is a proton trap for oxidative phosphorylation that impacts both diabetic heart disease and tangier disease. The molecule is a apoptosis and cholesterol translocation, and it impacts non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase, impacting both barth syndrome and aging.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Come up with a molecule based on the description: The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation, impacting both tangier disease and aging. The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure, impacting both diabetic heart disease and barth syndrome. The molecule is a apoptosis that impacts non-alcoholic fatty liver disease.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Come up with a molecule based on the description: The molecule is a proton trap for oxidative phosphorylation, a cholesterol translocation, and a apoptosis. The molecule is a stabilizing cytochrome oxidase that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging. The molecule is a stabilizing mitochondrial structure that impacts both barth syndrome and tangier disease.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Come up with a molecule based on the description: The molecule is a cholesterol translocation, apoptosis, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts tangier disease. The molecule is a stabilizing cytochrome oxidase that impacts aging, barth syndrome, non-alcoholic fatty liver disease, and diabetic heart disease.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, stabilizing mitochondrial structure that impacts barth syndrome and aging. The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts tangier disease, diabetic heart disease, and non-alcoholic fatty liver disease.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation, impacting both diabetic heart disease and tangier disease. The molecule is a apoptosis that impacts barth syndrome, non-alcoholic fatty liver disease, and aging. The molecule is both a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I need a molecule that meets the following conditions: The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts barth syndrome, non-alcoholic fatty liver disease, and tangier disease. The molecule is a apoptosis, cholesterol translocation, stabilizing mitochondrial structure that impacts diabetic heart disease and aging. Please represent the molecule in SMILES.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a proton trap for oxidative phosphorylation and stabilizing cytochrome oxidase, and it impacts barth syndrome. The molecule is a cholesterol translocation that impacts both non-alcoholic fatty liver disease and aging. The molecule is a stabilizing mitochondrial structure and a apoptosis, impacting both diabetic heart disease and tangier disease.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing mitochondrial structure that impacts barth syndrome, aging, and tangier disease. The molecule is a proton trap for oxidative phosphorylation, apoptosis, stabilizing cytochrome oxidase that impacts diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "The molecule is a apoptosis that impacts tangier disease, diabetic heart disease, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts aging. Use the above information to create a molecule.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Build a molecule that meets the requirement: The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, barth syndrome, and aging. The molecule is a apoptosis and a cholesterol translocation, impacting both tangier disease and diabetic heart disease.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)CC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule based on this description: The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts non-alcoholic fatty liver disease, barth syndrome, and tangier disease. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, apoptosis that impacts diabetic heart disease and aging.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)CC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Build a molecule that meets the requirement: The molecule is a apoptosis, cholesterol translocation, proton trap for oxidative phosphorylation that impacts barth syndrome and aging. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, tangier disease, and diabetic heart disease.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)CC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a cholesterol translocation that impacts aging, non-alcoholic fatty liver disease, and diabetic heart disease. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation, impacting both barth syndrome and tangier disease. The molecule is both a stabilizing cytochrome oxidase and a apoptosis.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)CC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Suppose there is a molecule that meets the following description: The molecule is a proton trap for oxidative phosphorylation and stabilizing mitochondrial structure, and it impacts tangier disease. The molecule is a stabilizing cytochrome oxidase, a cholesterol translocation, and a apoptosis, and it impacts non-alcoholic fatty liver disease. It impacts aging, diabetic heart disease, and barth syndrome. Please write the SMILES representation of it.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCC(C)CC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Suppose there is a molecule that meets the following description: It belongs to the liquid crystal class of molecules. Please write the SMILES representation of it.", "role": "user" }, { "content": "CCCCCC1CCC(CCC2CCC(C(CO)COC3CCCCO3)CC2)CC1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a liquid crystal.", "role": "user" }, { "content": "CCCCCC1CCC(CCC2CCC(C(CO)COC3CCCCO3)CC2)CC1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I need a molecule that meets the following conditions: The molecule is a liquid crystal. Please represent the molecule in SMILES.", "role": "user" }, { "content": "CCCCCC1CCC(CCC2CCC(C(CO)COC3CCCCO3)CC2)CC1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I need a molecule that meets the following conditions: The molecule is a liquid crystal. Please represent the molecule in SMILES.", "role": "user" }, { "content": "CCCCCC1CCC(CCC2CCC(C(CO)COC3CCCCO3)CC2)CC1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? It belongs to the liquid crystal class of molecules.", "role": "user" }, { "content": "CCCCCC1CCC(CCC2CCC(C(CO)COC3CCCCO3)CC2)CC1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I need a molecule that meets the following conditions: The molecule is a apoptosis that impacts aging, non-alcoholic fatty liver disease, and tangier disease. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, cholesterol translocation that impacts barth syndrome and diabetic heart disease. Please represent the molecule in SMILES.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a apoptosis. The molecule is a proton trap for oxidative phosphorylation, a stabilizing mitochondrial structure, and a cholesterol translocation, and it impacts barth syndrome. The molecule is a stabilizing cytochrome oxidase that impacts diabetic heart disease, non-alcoholic fatty liver disease, aging, and tangier disease.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Can you create a molecule that matches the given characteristics? It impacts tangier disease. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation, impacting both diabetic heart disease and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, apoptosis that impacts aging and barth syndrome.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Come up with a molecule based on the description: The molecule is a proton trap for oxidative phosphorylation that impacts both aging and barth syndrome. The molecule is a cholesterol translocation, a stabilizing cytochrome oxidase, and a apoptosis, and it impacts diabetic heart disease. The molecule is a stabilizing mitochondrial structure that impacts both non-alcoholic fatty liver disease and tangier disease.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: It impacts diabetic heart disease, tangier disease, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, cholesterol translocation, stabilizing mitochondrial structure that impacts aging. The molecule is a apoptosis.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Suppose there is a molecule that meets the following description: The molecule is a protein kinase inhibitor. Please write the SMILES representation of it.", "role": "user" }, { "content": "O=C(O)NCC1CCN(c2nc(-c3ccnc(Cl)c3)cc3cnccc23)CC1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule based on this description: The molecule is a protein kinase inhibitor.", "role": "user" }, { "content": "O=C(O)NCC1CCN(c2nc(-c3ccnc(Cl)c3)cc3cnccc23)CC1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a protein kinase inhibitor.", "role": "user" }, { "content": "O=C(O)NCC1CCN(c2nc(-c3ccnc(Cl)c3)cc3cnccc23)CC1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Come up with a molecule based on the description: The molecule is a protein kinase inhibitor.", "role": "user" }, { "content": "O=C(O)NCC1CCN(c2nc(-c3ccnc(Cl)c3)cc3cnccc23)CC1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a protein kinase inhibitor.", "role": "user" }, { "content": "O=C(O)NCC1CCN(c2nc(-c3ccnc(Cl)c3)cc3cnccc23)CC1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Come up with a molecule based on the description: The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, apoptosis that impacts diabetic heart disease, tangier disease, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure, impacting both aging and barth syndrome.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule based on this description: The molecule is a apoptosis, stabilizing cytochrome oxidase, cholesterol translocation that impacts non-alcoholic fatty liver disease and barth syndrome. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts aging, diabetic heart disease, and tangier disease.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I need a molecule that meets the following conditions: It impacts tangier disease. The molecule is a stabilizing mitochondrial structure, a proton trap for oxidative phosphorylation, and a cholesterol translocation, and it impacts aging. The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts diabetic heart disease, barth syndrome, and non-alcoholic fatty liver disease. Please represent the molecule in SMILES.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? The molecule is a stabilizing mitochondrial structure. The molecule is a apoptosis that impacts tangier disease, barth syndrome, and diabetic heart disease. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and aging.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Come up with a molecule based on the description: The molecule is a stabilizing cytochrome oxidase and a apoptosis, impacting both tangier disease and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing mitochondrial structure that impacts barth syndrome, aging, and diabetic heart disease.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? The molecule is a paf antagonist.", "role": "user" }, { "content": "CCCS(=O)(=O)c1cc(C2CC(c3cc(OC)c(OC)c(OC)c3)CO2)cc(OC)c1OCc1ccccc1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Suppose there is a molecule that meets the following description: It belongs to the paf antagonist class of molecules. Please write the SMILES representation of it.", "role": "user" }, { "content": "CCCS(=O)(=O)c1cc(C2CC(c3cc(OC)c(OC)c(OC)c3)CO2)cc(OC)c1OCc1ccccc1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: It belongs to the paf antagonist class of molecules.", "role": "user" }, { "content": "CCCS(=O)(=O)c1cc(C2CC(c3cc(OC)c(OC)c(OC)c3)CO2)cc(OC)c1OCc1ccccc1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "The molecule is a paf antagonist. Use the above information to create a molecule.", "role": "user" }, { "content": "CCCS(=O)(=O)c1cc(C2CC(c3cc(OC)c(OC)c(OC)c3)CO2)cc(OC)c1OCc1ccccc1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a paf antagonist.", "role": "user" }, { "content": "CCCS(=O)(=O)c1cc(C2CC(c3cc(OC)c(OC)c(OC)c3)CO2)cc(OC)c1OCc1ccccc1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? The molecule is a energy source, energy storage, inflammatory that impacts obesity and cardiovascular disease. The molecule is a membrane stabilizer that impacts atherosclerosis, cancer, pancreatitis, metabolic syndrome, and thyroxine treatment. The molecule is both a nutrient and a fat storage.", "role": "user" }, { "content": "CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Come up with a molecule based on the description: It impacts cardiovascular disease. The molecule is a nutrient, membrane stabilizer, and energy storage that has an effect on cancer and impacts both obesity and thyroxine treatment. The molecule is a inflammatory, energy source, fat storage that impacts atherosclerosis, metabolic syndrome, and pancreatitis.", "role": "user" }, { "content": "CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a energy source. The molecule is a inflammatory, membrane stabilizer, energy storage, belonging to the thyroxine treatment class of molecules, and it has an effect on cancer as well as impacts metabolic syndrome. The molecule is a fat storage and a nutrient that impacts cardiovascular disease, pancreatitis, atherosclerosis, and obesity.", "role": "user" }, { "content": "CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Can you create a molecule that matches the given characteristics? The molecule is a nutrient and a membrane stabilizer that impacts metabolic syndrome, pancreatitis, obesity, and cancer. The molecule is a fat storage and a inflammatory, belonging to the thyroxine treatment class of molecules. The molecule is a energy storage and a energy source, impacting both cardiovascular disease and atherosclerosis.", "role": "user" }, { "content": "CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Can you create a molecule that matches the given characteristics? The molecule is a nutrient and a inflammatory, it impacts atherosclerosis, and is thyroxine treatment. The molecule is a fat storage and a membrane stabilizer that impacts cancer, metabolic syndrome, and cardiovascular disease. The molecule is a energy source and a energy storage, impacting both obesity and pancreatitis.", "role": "user" }, { "content": "CCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule based on this description: The molecule is a stabilizing cytochrome oxidase, a cholesterol translocation, and a proton trap for oxidative phosphorylation, and it impacts diabetic heart disease. The molecule is a apoptosis and a stabilizing mitochondrial structure that impacts barth syndrome, aging, and non-alcoholic fatty liver disease. It impacts tangier disease.", "role": "user" }, { "content": "CCCCCCC=CC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Suppose there is a molecule that meets the following description: The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, cholesterol translocation that impacts tangier disease, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a apoptosis and a stabilizing mitochondrial structure, impacting both diabetic heart disease and aging. Please write the SMILES representation of it.", "role": "user" }, { "content": "CCCCCCC=CC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Can you create a molecule that matches the given characteristics? The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts aging and barth syndrome. The molecule is a cholesterol translocation and a apoptosis that impacts tangier disease, non-alcoholic fatty liver disease, and diabetic heart disease.", "role": "user" }, { "content": "CCCCCCC=CC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Build a molecule that meets the requirement: The molecule is a apoptosis that impacts aging, tangier disease, and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase, cholesterol translocation, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts diabetic heart disease. It impacts barth syndrome.", "role": "user" }, { "content": "CCCCCCC=CC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? The molecule is a stabilizing cytochrome oxidase, apoptosis, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts aging. The molecule is a cholesterol translocation that impacts barth syndrome, tangier disease, non-alcoholic fatty liver disease, and diabetic heart disease.", "role": "user" }, { "content": "CCCCCCC=CC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCCCC", "role": "assistant" } ]