messages
listlengths
3
3
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I need a molecule that meets the following conditions: It impacts cancer treatment. Please represent the molecule in SMILES.", "role": "user" }, { "content": "NC(=S)NC(=O)Cc1cccc(-c2cccc(F)c2)c1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Can you create a molecule that matches the given characteristics? The molecule is a cancer treatment.", "role": "user" }, { "content": "NC(=S)NC(=O)Cc1cccc(-c2cccc(F)c2)c1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Suppose there is a molecule that meets the following description: The molecule is a cancer treatment. Please write the SMILES representation of it.", "role": "user" }, { "content": "NC(=S)NC(=O)Cc1cccc(-c2cccc(F)c2)c1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a cancer treatment.", "role": "user" }, { "content": "NC(=S)NC(=O)Cc1cccc(-c2cccc(F)c2)c1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Come up with a molecule based on the description: It belongs to the cancer treatment class of molecules.", "role": "user" }, { "content": "NC(=S)NC(=O)Cc1cccc(-c2cccc(F)c2)c1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a inflammatory and fat storage, and it impacts thyroxine treatment. The molecule is a nutrient and a energy storage, impacting both obesity and cancer. The molecule is a membrane stabilizer and a energy source that impacts pancreatitis, metabolic syndrome, cardiovascular disease, and atherosclerosis.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a fat storage and energy storage, and it impacts cancer. The molecule is a energy source and thyroxine treatment, impacting metabolic syndrome, atherosclerosis, and cardiovascular disease. The molecule is a membrane stabilizer, nutrient, inflammatory that impacts pancreatitis and obesity.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Build a molecule that meets the requirement: The molecule is a energy storage and a energy source, impacting both cardiovascular disease and atherosclerosis. The molecule is a membrane stabilizer and a fat storage, with effects on cancer and impacts on pancreatitis. The molecule is a inflammatory and a nutrient, which impacts both metabolic syndrome and obesity, and is characterized as thyroxine treatment.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Suppose there is a molecule that meets the following description: The molecule is a fat storage, energy storage, energy source that impacts thyroxine treatment and atherosclerosis. The molecule is a inflammatory and a nutrient, impacting both cardiovascular disease and pancreatitis. The molecule is a membrane stabilizer that impacts cancer, obesity, and metabolic syndrome. Please write the SMILES representation of it.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a membrane stabilizer, a energy storage, and a energy source, and it impacts cancer. The molecule is a member of the thyroxine treatment class and affects metabolic syndrome, obesity, and pancreatitis. The molecule is a nutrient, fat storage, inflammatory that impacts cardiovascular disease and atherosclerosis.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? The molecule has Odorless.", "role": "user" }, { "content": "Cl.NNc1nncc2ccccc12", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule has Odorless.", "role": "user" }, { "content": "Cl.NNc1nncc2ccccc12", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Come up with a molecule based on the description: The molecule has Odorless.", "role": "user" }, { "content": "Cl.NNc1nncc2ccccc12", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Conceptualize a molecule that meets the specified attribute(s): The molecule has Odorless.", "role": "user" }, { "content": "Cl.NNc1nncc2ccccc12", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule based on this description: The molecule has Odorless.", "role": "user" }, { "content": "Cl.NNc1nncc2ccccc12", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule based on this description: The molecule is a nutrient that impacts alzheimer's disease, non-alcoholic fatty liver disease, parkinson's disease, and diabetes mellitus type 2.", "role": "user" }, { "content": "CCCCC=CCCCCCCCC(=O)OC(COC(=O)CCCC1OC1CC=CCC=CCC=CCCCCC)COP(=O)(O)OCCN", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule based on this description: The molecule is a nutrient that impacts parkinson's disease, diabetes mellitus type 2, alzheimer's disease, and non-alcoholic fatty liver disease.", "role": "user" }, { "content": "CCCCC=CCCCCCCCC(=O)OC(COC(=O)CCCC1OC1CC=CCC=CCC=CCCCCC)COP(=O)(O)OCCN", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "The molecule is a nutrient that impacts diabetes mellitus type 2, non-alcoholic fatty liver disease, parkinson's disease, and alzheimer's disease. Use the above information to create a molecule.", "role": "user" }, { "content": "CCCCC=CCCCCCCCC(=O)OC(COC(=O)CCCC1OC1CC=CCC=CCC=CCCCCC)COP(=O)(O)OCCN", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a nutrient that impacts non-alcoholic fatty liver disease, parkinson's disease, diabetes mellitus type 2, and alzheimer's disease.", "role": "user" }, { "content": "CCCCC=CCCCCCCCC(=O)OC(COC(=O)CCCC1OC1CC=CCC=CCC=CCCCCC)COP(=O)(O)OCCN", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Suppose there is a molecule that meets the following description: The molecule is a nutrient that impacts both alzheimer's disease and non-alcoholic fatty liver disease. It impacts both diabetes mellitus type 2 and parkinson's disease. Please write the SMILES representation of it.", "role": "user" }, { "content": "CCCCC=CCCCCCCCC(=O)OC(COC(=O)CCCC1OC1CC=CCC=CCC=CCCCCC)COP(=O)(O)OCCN", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Suppose there is a molecule that meets the following description: The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, apoptosis that impacts diabetic heart disease and barth syndrome. The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts tangier disease, aging, and non-alcoholic fatty liver disease. Please write the SMILES representation of it.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule that fulfills the requirement: The molecule is a proton trap for oxidative phosphorylation, a stabilizing mitochondrial structure, and a apoptosis, and it impacts barth syndrome. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation, impacting both aging and non-alcoholic fatty liver disease. It impacts both diabetic heart disease and tangier disease.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? The molecule is a apoptosis, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts tangier disease and aging. The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts diabetic heart disease, non-alcoholic fatty liver disease, and barth syndrome.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Suppose there is a molecule that meets the following description: The molecule is a cholesterol translocation that impacts aging. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation, impacting both barth syndrome and tangier disease. The molecule is a apoptosis and a stabilizing mitochondrial structure, impacting both diabetic heart disease and non-alcoholic fatty liver disease. Please write the SMILES representation of it.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule that fulfills the requirement: The molecule is a stabilizing cytochrome oxidase that impacts both barth syndrome and diabetic heart disease. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation, impacting both aging and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure and apoptosis, and it impacts tangier disease.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule that fulfills the requirement: The molecule is a anti allergic that impacts asthma treatment.", "role": "user" }, { "content": "CC(NC(=O)N1CCN(c2ccccc2)CC1)N1CC=CCC1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Build a molecule that meets the requirement: The molecule is both a asthma treatment and a anti allergic.", "role": "user" }, { "content": "CC(NC(=O)N1CCN(c2ccccc2)CC1)N1CC=CCC1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule based on this description: It belongs to both the asthma treatment and anti allergic classes of molecules.", "role": "user" }, { "content": "CC(NC(=O)N1CCN(c2ccccc2)CC1)N1CC=CCC1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? The molecule is both a asthma treatment and a anti allergic.", "role": "user" }, { "content": "CC(NC(=O)N1CCN(c2ccccc2)CC1)N1CC=CCC1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is both a asthma treatment and a anti allergic.", "role": "user" }, { "content": "CC(NC(=O)N1CCN(c2ccccc2)CC1)N1CC=CCC1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? It influences breast cancer and ulcerative colitis. The molecule is a nutrient that impacts both atherosclerosis and cervical cancer.", "role": "user" }, { "content": "CCCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC1C(O)CC(O)OC1C=CC(O)CCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a nutrient that affects cervical cancer by impacting atherosclerosis, breast cancer, and ulcerative colitis.", "role": "user" }, { "content": "CCCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC1C(O)CC(O)OC1C=CC(O)CCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Build a molecule that meets the requirement: The molecule is a nutrient that affects breast cancer by impacting ulcerative colitis, cervical cancer, and atherosclerosis.", "role": "user" }, { "content": "CCCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC1C(O)CC(O)OC1C=CC(O)CCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? The molecule is a nutrient that impacts ulcerative colitis, atherosclerosis, breast cancer, and cervical cancer.", "role": "user" }, { "content": "CCCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC1C(O)CC(O)OC1C=CC(O)CCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Can you create a molecule that matches the given characteristics? The molecule is a nutrient that affects breast cancer by impacting ulcerative colitis, atherosclerosis, and cervical cancer.", "role": "user" }, { "content": "CCCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC1C(O)CC(O)OC1C=CC(O)CCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule that fulfills the requirement: The molecule is a apoptosis and cholesterol translocation, and it impacts barth syndrome. The molecule is a stabilizing cytochrome oxidase and proton trap for oxidative phosphorylation, and it impacts non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure that impacts aging, tangier disease, and diabetic heart disease.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Can you create a molecule that matches the given characteristics? The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts barth syndrome, diabetic heart disease, non-alcoholic fatty liver disease, and tangier disease. The molecule is a cholesterol translocation, a proton trap for oxidative phosphorylation, and a apoptosis, and it impacts aging.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Conceptualize a molecule that meets the specified attribute(s): It impacts aging. The molecule is a proton trap for oxidative phosphorylation and a apoptosis, impacting both non-alcoholic fatty liver disease and barth syndrome. The molecule is a cholesterol translocation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts tangier disease and diabetic heart disease.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a proton trap for oxidative phosphorylation that impacts both aging and diabetic heart disease. The molecule is a cholesterol translocation that impacts barth syndrome, non-alcoholic fatty liver disease, and tangier disease. The molecule is a stabilizing mitochondrial structure, a stabilizing cytochrome oxidase, and a apoptosis.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a apoptosis and stabilizing mitochondrial structure, and it impacts barth syndrome. It impacts non-alcoholic fatty liver disease, diabetic heart disease, and tangier disease. The molecule is a stabilizing cytochrome oxidase, a cholesterol translocation, and a proton trap for oxidative phosphorylation, and it impacts aging.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC(C)C", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "It impacts aging, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and stabilizing mitochondrial structure, and it impacts barth syndrome. The molecule is a stabilizing cytochrome oxidase, a apoptosis, and a cholesterol translocation, and it impacts tangier disease. Use the above information to create a molecule.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCC=CCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Come up with a molecule based on the description: It impacts barth syndrome. The molecule is a stabilizing cytochrome oxidase, a cholesterol translocation, and a stabilizing mitochondrial structure, and it impacts tangier disease. The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts non-alcoholic fatty liver disease, diabetic heart disease, and aging.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCC=CCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a stabilizing cytochrome oxidase that impacts diabetic heart disease, tangier disease, and aging. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, apoptosis, proton trap for oxidative phosphorylation that impacts non-alcoholic fatty liver disease and barth syndrome.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCC=CCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule that fulfills the requirement: The molecule is a proton trap for oxidative phosphorylation and a stabilizing mitochondrial structure that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging. The molecule is a apoptosis, stabilizing cytochrome oxidase, cholesterol translocation that impacts tangier disease and barth syndrome.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCC=CCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Can you create a molecule that matches the given characteristics? The molecule is a cholesterol translocation that impacts barth syndrome, aging, and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, apoptosis, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts diabetic heart disease and tangier disease.", "role": "user" }, { "content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCC=CCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule that fulfills the requirement: The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation, impacting both tangier disease and aging. The molecule is a stabilizing mitochondrial structure that impacts barth syndrome, non-alcoholic fatty liver disease, and diabetic heart disease. The molecule is both a apoptosis and a stabilizing cytochrome oxidase.", "role": "user" }, { "content": "CCCCCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule based on this description: The molecule is a apoptosis, a proton trap for oxidative phosphorylation, and a cholesterol translocation, and it impacts barth syndrome. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase, impacting both non-alcoholic fatty liver disease and aging. It impacts both diabetic heart disease and tangier disease.", "role": "user" }, { "content": "CCCCCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is both a cholesterol translocation and a stabilizing mitochondrial structure. The molecule is a stabilizing cytochrome oxidase that impacts aging, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and a apoptosis, impacting both tangier disease and diabetic heart disease.", "role": "user" }, { "content": "CCCCCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "The molecule is a cholesterol translocation. The molecule is a proton trap for oxidative phosphorylation, a stabilizing cytochrome oxidase, and a apoptosis, and it impacts aging. The molecule is a stabilizing mitochondrial structure that impacts tangier disease, non-alcoholic fatty liver disease, barth syndrome, and diabetic heart disease. Use the above information to create a molecule.", "role": "user" }, { "content": "CCCCCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a proton trap for oxidative phosphorylation, a stabilizing cytochrome oxidase, and a apoptosis, and it impacts aging. The molecule is a stabilizing mitochondrial structure that impacts tangier disease, diabetic heart disease, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a cholesterol translocation.", "role": "user" }, { "content": "CCCCCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCC=CCCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule based on this description: The molecule is a proton trap for oxidative phosphorylation that impacts both tangier disease and aging. The molecule is a cholesterol translocation, a stabilizing cytochrome oxidase, and a apoptosis. The molecule is a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, diabetic heart disease, and barth syndrome.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a apoptosis and a stabilizing cytochrome oxidase, impacting both aging and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts barth syndrome, tangier disease, and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Can you create a molecule that matches the given characteristics? The molecule is a apoptosis and a stabilizing cytochrome oxidase, impacting both non-alcoholic fatty liver disease and barth syndrome. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts aging, diabetic heart disease, and tangier disease.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule based on this description: The molecule is a cholesterol translocation. The molecule is a apoptosis and a stabilizing cytochrome oxidase, impacting both barth syndrome and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts aging, tangier disease, and diabetic heart disease.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts barth syndrome, diabetic heart disease, and tangier disease. The molecule is a cholesterol translocation, apoptosis, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and aging.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Thermal decomposition products include carbon dioxide and carbon monoxide. organic acids and related compounds/ Use the above information to create a molecule.", "role": "user" }, { "content": "O=C(O)c1cc(O)c(O)c(O)c1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule based on this description: Thermal decomposition products include carbon dioxide and carbon monoxide. organic acids and related compounds/", "role": "user" }, { "content": "O=C(O)c1cc(O)c(O)c(O)c1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Based on the given information, generate a molecule that meets the desired specifications: Thermal decomposition products include carbon dioxide and carbon monoxide. organic acids and related compounds/", "role": "user" }, { "content": "O=C(O)c1cc(O)c(O)c(O)c1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Thermal decomposition products include carbon dioxide and carbon monoxide. organic acids and related compounds/ Use the above information to create a molecule.", "role": "user" }, { "content": "O=C(O)c1cc(O)c(O)c(O)c1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Based on the given information, generate a molecule that meets the desired specifications: Thermal decomposition products include carbon dioxide and carbon monoxide. organic acids and related compounds/", "role": "user" }, { "content": "O=C(O)c1cc(O)c(O)c(O)c1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Build a molecule that meets the requirement: The molecule is a apoptosis that impacts barth syndrome, non-alcoholic fatty liver disease, and tangier disease. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation, impacting both diabetic heart disease and aging. The molecule is both a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation, impacting both barth syndrome and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, apoptosis that impacts diabetic heart disease and tangier disease. It impacts aging.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? The molecule is a stabilizing mitochondrial structure, a apoptosis, and a stabilizing cytochrome oxidase, and it impacts non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts barth syndrome, diabetic heart disease, aging, and tangier disease.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Build a molecule that meets the requirement: The molecule is a stabilizing cytochrome oxidase that impacts tangier disease. The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation, impacting both barth syndrome and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure and a apoptosis, impacting both diabetic heart disease and aging.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule that fulfills the requirement: The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts tangier disease, aging, and barth syndrome. The molecule is a apoptosis, cholesterol translocation, stabilizing mitochondrial structure that impacts diabetic heart disease and non-alcoholic fatty liver disease.", "role": "user" }, { "content": "CCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I need a molecule that meets the following conditions: The molecule is a anti inflammatory and belongs to the anti allergic class of molecules. Please represent the molecule in SMILES.", "role": "user" }, { "content": "NC1(Cc2ccccc2)NC(=O)NC1=O", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Come up with a molecule based on the description: The molecule is both a anti allergic and a anti inflammatory.", "role": "user" }, { "content": "NC1(Cc2ccccc2)NC(=O)NC1=O", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Suppose there is a molecule that meets the following description: The molecule is a anti allergic and is anti inflammatory. Please write the SMILES representation of it.", "role": "user" }, { "content": "NC1(Cc2ccccc2)NC(=O)NC1=O", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Build a molecule that meets the requirement: The molecule is a anti inflammatory and belongs to the anti allergic class of molecules.", "role": "user" }, { "content": "NC1(Cc2ccccc2)NC(=O)NC1=O", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule based on this description: It belongs to both the anti allergic and anti inflammatory classes of molecules.", "role": "user" }, { "content": "NC1(Cc2ccccc2)NC(=O)NC1=O", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Can you create a molecule that matches the given characteristics? The molecule is a energy source, nutrient, energy storage, herb, and woody. The molecule is a emulsifier, surfactant, membrane stabilizer, flavoring agent, and herbal.", "role": "user" }, { "content": "CC(CO)CC(=O)CC1(C)CCC(c2ccoc2)O1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I need a molecule that meets the following conditions: The molecule is a energy source, a nutrient, and herb. The molecule is a energy storage that is herbal and woody. The molecule is a membrane stabilizer, emulsifier, flavoring agent, surfactant. Please represent the molecule in SMILES.", "role": "user" }, { "content": "CC(CO)CC(=O)CC1(C)CCC(c2ccoc2)O1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Build a molecule that meets the requirement: The molecule is a energy source, membrane stabilizer, energy storage, flavoring agent, surfactant, and woody. The molecule is a nutrient and a emulsifier, as well as herbal and herb.", "role": "user" }, { "content": "CC(CO)CC(=O)CC1(C)CCC(c2ccoc2)O1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? The molecule is a energy source. The molecule is a energy storage, nutrient, flavoring agent, surfactant. The molecule is a emulsifier, a membrane stabilizer, herbal, woody, and herb.", "role": "user" }, { "content": "CC(CO)CC(=O)CC1(C)CCC(c2ccoc2)O1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Come up with a molecule based on the description: The molecule is a nutrient and is herbal. The molecule is a flavoring agent and a emulsifier, as well as woody and herb. The molecule is a energy storage, membrane stabilizer, surfactant, energy source.", "role": "user" }, { "content": "CC(CO)CC(=O)CC1(C)CCC(c2ccoc2)O1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a liquid crystal.", "role": "user" }, { "content": "CC=COc1ccc2c(ccc3c(F)c(OC)ccc32)c1F", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "The molecule is a liquid crystal. Use the above information to create a molecule.", "role": "user" }, { "content": "CC=COc1ccc2c(ccc3c(F)c(OC)ccc32)c1F", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule based on this description: It belongs to the liquid crystal class of molecules.", "role": "user" }, { "content": "CC=COc1ccc2c(ccc3c(F)c(OC)ccc32)c1F", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? The molecule is a liquid crystal.", "role": "user" }, { "content": "CC=COc1ccc2c(ccc3c(F)c(OC)ccc32)c1F", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Generate a molecule based on this description: The molecule is a liquid crystal.", "role": "user" }, { "content": "CC=COc1ccc2c(ccc3c(F)c(OC)ccc32)c1F", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is both a jak inhibitor and a protein kinase inhibitor.", "role": "user" }, { "content": "C=CC(=O)N1CCC(Nc2cnc3[nH]cc(C(=O)NC(C)C(=O)NCCC#N)c3n2)CC1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Can you create a molecule that matches the given characteristics? The molecule is both a protein kinase inhibitor and a jak inhibitor.", "role": "user" }, { "content": "C=CC(=O)N1CCC(Nc2cnc3[nH]cc(C(=O)NC(C)C(=O)NCCC#N)c3n2)CC1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is both a protein kinase inhibitor and a jak inhibitor.", "role": "user" }, { "content": "C=CC(=O)N1CCC(Nc2cnc3[nH]cc(C(=O)NC(C)C(=O)NCCC#N)c3n2)CC1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is both a protein kinase inhibitor and a jak inhibitor.", "role": "user" }, { "content": "C=CC(=O)N1CCC(Nc2cnc3[nH]cc(C(=O)NC(C)C(=O)NCCC#N)c3n2)CC1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "The molecule is both a protein kinase inhibitor and a jak inhibitor. Use the above information to create a molecule.", "role": "user" }, { "content": "C=CC(=O)N1CCC(Nc2cnc3[nH]cc(C(=O)NC(C)C(=O)NCCC#N)c3n2)CC1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? The molecule is a rsv inhibitor.", "role": "user" }, { "content": "C=C(OCC)c1cn(C)nc1N1CCOCC1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Suppose there is a molecule that meets the following description: The molecule is a rsv inhibitor. Please write the SMILES representation of it.", "role": "user" }, { "content": "C=C(OCC)c1cn(C)nc1N1CCOCC1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a rsv inhibitor.", "role": "user" }, { "content": "C=C(OCC)c1cn(C)nc1N1CCOCC1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Could you please return a molecule that adheres to this description? The molecule is a rsv inhibitor.", "role": "user" }, { "content": "C=C(OCC)c1cn(C)nc1N1CCOCC1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a rsv inhibitor.", "role": "user" }, { "content": "C=C(OCC)c1cn(C)nc1N1CCOCC1", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a energy storage, membrane stabilizer, nutritional supplement, emulsifier, cholesterol translocation that impacts aging. The molecule is a stabilizing mitochondrial structure and food additive, and it impacts diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and a energy source, it impacts barth syndrome, and is smooth. The molecule is a surfactant, proton trap for oxidative phosphorylation, apoptosis that impacts tangier disease and non-alcoholic fatty liver disease.", "role": "user" }, { "content": "CCC(C)CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Can you create a molecule that matches the given characteristics? The molecule is a energy source, a stabilizing cytochrome oxidase, and a nutritional supplement, and it impacts aging. The molecule is a food additive, a surfactant, and a membrane stabilizer, it impacts barth syndrome and is smooth. The molecule is a emulsifier and a stabilizing mitochondrial structure, impacting both non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation, energy storage, apoptosis, cholesterol translocation that impacts tangier disease.", "role": "user" }, { "content": "CCC(C)CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is smooth and it impacts diabetic heart disease. The molecule is a emulsifier, apoptosis, energy storage, nutritional supplement. The molecule is a membrane stabilizer, a cholesterol translocation, and a surfactant, and it impacts tangier disease. The molecule is a food additive, a proton trap for oxidative phosphorylation, and a energy source, and it impacts non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure, impacting both aging and barth syndrome.", "role": "user" }, { "content": "CCC(C)CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Suppose there is a molecule that meets the following description: The molecule is a surfactant, a energy storage, and a emulsifier, and it impacts barth syndrome. The molecule is a food additive, a stabilizing cytochrome oxidase, and a proton trap for oxidative phosphorylation, and it impacts non-alcoholic fatty liver disease. The molecule is a energy source, a stabilizing mitochondrial structure, and a membrane stabilizer, it impacts aging and is smooth. The molecule is a nutritional supplement, cholesterol translocation, apoptosis that impacts tangier disease and diabetic heart disease. Please write the SMILES representation of it.", "role": "user" }, { "content": "CCC(C)CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Suppose there is a molecule that meets the following description: The molecule is a nutritional supplement, stabilizing mitochondrial structure, energy storage, proton trap for oxidative phosphorylation, surfactant, energy source. The molecule is a membrane stabilizer and a emulsifier, which impacts non-alcoholic fatty liver disease, diabetic heart disease, and tangier disease, and is characterized as smooth. The molecule is a food additive, apoptosis, stabilizing cytochrome oxidase, cholesterol translocation that impacts aging and barth syndrome. Please write the SMILES representation of it.", "role": "user" }, { "content": "CCC(C)CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)CC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Can you create a molecule that matches the given characteristics? It impacts both parkinson's disease and diabetes mellitus type 2. The molecule is a nutrient that impacts both alzheimer's disease and non-alcoholic fatty liver disease.", "role": "user" }, { "content": "CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCC=CCC=CC=CC(O)CC=CCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a nutrient that impacts alzheimer's disease, non-alcoholic fatty liver disease, parkinson's disease, and diabetes mellitus type 2.", "role": "user" }, { "content": "CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCC=CCC=CC=CC(O)CC=CCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a nutrient that impacts both parkinson's disease and diabetes mellitus type 2. It impacts both non-alcoholic fatty liver disease and alzheimer's disease.", "role": "user" }, { "content": "CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCC=CCC=CC=CC(O)CC=CCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "I need a molecule that meets the following conditions: The molecule is a nutrient that impacts alzheimer's disease, parkinson's disease, diabetes mellitus type 2, and non-alcoholic fatty liver disease. Please represent the molecule in SMILES.", "role": "user" }, { "content": "CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCC=CCC=CC=CC(O)CC=CCCCCC", "role": "assistant" } ]
[ { "content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.", "role": "system" }, { "content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a nutrient. It impacts diabetes mellitus type 2, alzheimer's disease, parkinson's disease, and non-alcoholic fatty liver disease.", "role": "user" }, { "content": "CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCC=CCC=CC=CC(O)CC=CCCCCC", "role": "assistant" } ]