messages
listlengths 3
3
|
|---|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a hmgcoa reductase inhibitor.",
"role": "user"
},
{
"content": "CC(C)Cc1nc(N(C)S(C)(=O)=O)nc(-c2ccc(F)cc2)c1CO",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a hmgcoa reductase inhibitor.",
"role": "user"
},
{
"content": "CC(C)Cc1nc(N(C)S(C)(=O)=O)nc(-c2ccc(F)cc2)c1CO",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a hmgcoa reductase inhibitor.",
"role": "user"
},
{
"content": "CC(C)Cc1nc(N(C)S(C)(=O)=O)nc(-c2ccc(F)cc2)c1CO",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a hmgcoa reductase inhibitor.",
"role": "user"
},
{
"content": "CC(C)Cc1nc(N(C)S(C)(=O)=O)nc(-c2ccc(F)cc2)c1CO",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a hmgcoa reductase inhibitor. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CC(C)Cc1nc(N(C)S(C)(=O)=O)nc(-c2ccc(F)cc2)c1CO",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a cholesterol translocation and proton trap for oxidative phosphorylation, and it impacts diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and a apoptosis, impacting both tangier disease and barth syndrome. The molecule is a stabilizing mitochondrial structure that impacts both aging and non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, apoptosis that impacts aging and diabetic heart disease. The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts tangier disease, non-alcoholic fatty liver disease, and barth syndrome.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts barth syndrome, aging, and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation, apoptosis, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and tangier disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a apoptosis, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts barth syndrome and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, aging, and tangier disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation, impacting both tangier disease and diabetic heart disease. The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts aging, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is light-emitting.",
"role": "user"
},
{
"content": "Cc1ccccc1N(c1cccc(-c2cccc3c2oc2ccccc23)c1)c1ccc2ccc3c(N(c4cccc(-c5cccc6c5oc5ccccc56)c4)c4ccccc4C)ccc4ccc1c2c43",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? It belongs to the light-emitting class of molecules.",
"role": "user"
},
{
"content": "Cc1ccccc1N(c1cccc(-c2cccc3c2oc2ccccc23)c1)c1ccc2ccc3c(N(c4cccc(-c5cccc6c5oc5ccccc56)c4)c4ccccc4C)ccc4ccc1c2c43",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is light-emitting.",
"role": "user"
},
{
"content": "Cc1ccccc1N(c1cccc(-c2cccc3c2oc2ccccc23)c1)c1ccc2ccc3c(N(c4cccc(-c5cccc6c5oc5ccccc56)c4)c4ccccc4C)ccc4ccc1c2c43",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "It belongs to the light-emitting class of molecules. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "Cc1ccccc1N(c1cccc(-c2cccc3c2oc2ccccc23)c1)c1ccc2ccc3c(N(c4cccc(-c5cccc6c5oc5ccccc56)c4)c4ccccc4C)ccc4ccc1c2c43",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is light-emitting.",
"role": "user"
},
{
"content": "Cc1ccccc1N(c1cccc(-c2cccc3c2oc2ccccc23)c1)c1ccc2ccc3c(N(c4cccc(-c5cccc6c5oc5ccccc56)c4)c4ccccc4C)ccc4ccc1c2c43",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? It impacts both pick's disease and diabetes mellitus type 2. The molecule is a nutrient that impacts insulin resistance, atherosclerosis, diabetes mellitus type 1, and cardiovascular disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC(O)C=CC=CCC=CCCCC(=O)NC(COP(=O)([O-])OCC[N+](C)(C)C)C(O)CCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: It impacts pick's disease, diabetes mellitus type 2, insulin resistance, and diabetes mellitus type 1. The molecule is a nutrient that impacts both cardiovascular disease and atherosclerosis.",
"role": "user"
},
{
"content": "CCC=CCC=CCC(O)C=CC=CCC=CCCCC(=O)NC(COP(=O)([O-])OCC[N+](C)(C)C)C(O)CCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: It impacts both diabetes mellitus type 1 and atherosclerosis. The molecule is a nutrient that impacts cardiovascular disease, insulin resistance, diabetes mellitus type 2, and pick's disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC(O)C=CC=CCC=CCCCC(=O)NC(COP(=O)([O-])OCC[N+](C)(C)C)C(O)CCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: It impacts atherosclerosis, diabetes mellitus type 1, cardiovascular disease, pick's disease, and diabetes mellitus type 2. The molecule is a nutrient that impacts insulin resistance.",
"role": "user"
},
{
"content": "CCC=CCC=CCC(O)C=CC=CCC=CCCCC(=O)NC(COP(=O)([O-])OCC[N+](C)(C)C)C(O)CCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: It impacts pick's disease, diabetes mellitus type 1, insulin resistance, atherosclerosis, and cardiovascular disease. The molecule is a nutrient that impacts diabetes mellitus type 2.",
"role": "user"
},
{
"content": "CCC=CCC=CCC(O)C=CC=CCC=CCCCC(=O)NC(COP(=O)([O-])OCC[N+](C)(C)C)C(O)CCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a organic electroluminescent material and phosphorescent, belonging to the phosphorescent emitter class of molecules, and is electroluminescent.",
"role": "user"
},
{
"content": "O=P1(c2ccccc2)c2ccccc2-c2ccc3c4ccccc4n(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3c2N1c1ccccc1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a organic electroluminescent material. The molecule is a phosphorescent and belongs to both the electroluminescent and phosphorescent emitter classes of molecules.",
"role": "user"
},
{
"content": "O=P1(c2ccccc2)c2ccccc2-c2ccc3c4ccccc4n(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3c2N1c1ccccc1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is a organic electroluminescent material and belongs to the phosphorescent emitter, phosphorescent, and electroluminescent classes of molecules. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "O=P1(c2ccccc2)c2ccccc2-c2ccc3c4ccccc4n(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3c2N1c1ccccc1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a phosphorescent emitter and belongs to the organic electroluminescent material class of molecules, with the characteristic of being electroluminescent. The molecule is a phosphorescent.",
"role": "user"
},
{
"content": "O=P1(c2ccccc2)c2ccccc2-c2ccc3c4ccccc4n(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3c2N1c1ccccc1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a phosphorescent emitter, phosphorescent, organic electroluminescent material and belongs to the electroluminescent class of molecules.",
"role": "user"
},
{
"content": "O=P1(c2ccccc2)c2ccccc2-c2ccc3c4ccccc4n(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3c2N1c1ccccc1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a fat storage and nutrient, and it impacts cardiovascular disease. The molecule is a thyroxine treatment that impacts metabolic syndrome, pancreatitis, and atherosclerosis.",
"role": "user"
},
{
"content": "CCCCCCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a fat storage and thyroxine treatment, impacting both metabolic syndrome and pancreatitis. The molecule is a nutrient that impacts both cardiovascular disease and atherosclerosis.",
"role": "user"
},
{
"content": "CCCCCCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a fat storage that impacts thyroxine treatment, metabolic syndrome, and cardiovascular disease. The molecule is a nutrient that impacts both pancreatitis and atherosclerosis.",
"role": "user"
},
{
"content": "CCCCCCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a nutrient, thyroxine treatment, fat storage that impacts metabolic syndrome, pancreatitis, and atherosclerosis. It impacts cardiovascular disease.",
"role": "user"
},
{
"content": "CCCCCCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a nutrient that impacts both pancreatitis and atherosclerosis. The molecule is a fat storage and belongs to the thyroxine treatment class of molecules, impacting both metabolic syndrome and cardiovascular disease.",
"role": "user"
},
{
"content": "CCCCCCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is anti oxidant. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "C=C(C(=CC1C(O)=CC(O)=CC1C)CC1CC(O)C(O)C(O)C1O)c1ccc(O)c(O)c1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a anti oxidant.",
"role": "user"
},
{
"content": "C=C(C(=CC1C(O)=CC(O)=CC1C)CC1CC(O)C(O)C(O)C1O)c1ccc(O)c(O)c1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is anti oxidant. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "C=C(C(=CC1C(O)=CC(O)=CC1C)CC1CC(O)C(O)C(O)C1O)c1ccc(O)c(O)c1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a anti oxidant.",
"role": "user"
},
{
"content": "C=C(C(=CC1C(O)=CC(O)=CC1C)CC1CC(O)C(O)C(O)C1O)c1ccc(O)c(O)c1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): It belongs to the anti oxidant class of molecules.",
"role": "user"
},
{
"content": "C=C(C(=CC1C(O)=CC(O)=CC1C)CC1CC(O)C(O)C(O)C1O)c1ccc(O)c(O)c1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a ccr2 antagonist.",
"role": "user"
},
{
"content": "Cc1c(Nc2ccc(Cl)c(Cl)c2)nc(C2CC2)nc1C(=O)N1CCC(NC2CCOCC2F)CC1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: It belongs to the ccr2 antagonist class of molecules.",
"role": "user"
},
{
"content": "Cc1c(Nc2ccc(Cl)c(Cl)c2)nc(C2CC2)nc1C(=O)N1CCC(NC2CCOCC2F)CC1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: It belongs to the ccr2 antagonist class of molecules. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "Cc1c(Nc2ccc(Cl)c(Cl)c2)nc(C2CC2)nc1C(=O)N1CCC(NC2CCOCC2F)CC1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a ccr2 antagonist.",
"role": "user"
},
{
"content": "Cc1c(Nc2ccc(Cl)c(Cl)c2)nc(C2CC2)nc1C(=O)N1CCC(NC2CCOCC2F)CC1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: It belongs to the ccr2 antagonist class of molecules.",
"role": "user"
},
{
"content": "Cc1c(Nc2ccc(Cl)c(Cl)c2)nc(C2CC2)nc1C(=O)N1CCC(NC2CCOCC2F)CC1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? It impacts barth syndrome, tangier disease, and aging. The molecule is a apoptosis and stabilizing mitochondrial structure, and it impacts non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, a stabilizing cytochrome oxidase, and a cholesterol translocation, and it impacts diabetic heart disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: It impacts aging, non-alcoholic fatty liver disease, and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and cholesterol translocation, and it impacts barth syndrome. The molecule is a stabilizing mitochondrial structure, a proton trap for oxidative phosphorylation, and a apoptosis, and it impacts tangier disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a cholesterol translocation and apoptosis, and it impacts diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation, a stabilizing cytochrome oxidase, and a stabilizing mitochondrial structure, and it impacts tangier disease. It impacts non-alcoholic fatty liver disease, barth syndrome, and aging.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a apoptosis, cholesterol translocation, stabilizing mitochondrial structure that impacts barth syndrome and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts diabetic heart disease, tangier disease, and aging.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a stabilizing cytochrome oxidase that impacts both tangier disease and barth syndrome. The molecule is a apoptosis and stabilizing mitochondrial structure, and it impacts diabetic heart disease. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation, impacting both aging and non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a energy source that affects breast cancer by impacting both celiac disease and heart failure. It impacts inflammatory bowel disease, renal cell carcinoma, diabetes mellitus type 2, and cardiovascular disease.",
"role": "user"
},
{
"content": "CCCCCC=CCCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a energy source that impacts celiac disease, heart failure, diabetes mellitus type 2, and renal cell carcinoma. It has an effect on breast cancer, impacting both cardiovascular disease and inflammatory bowel disease.",
"role": "user"
},
{
"content": "CCCCCC=CCCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? It impacts renal cell carcinoma. The molecule is a energy source that affects breast cancer by impacting cardiovascular disease. It impacts heart failure, celiac disease, diabetes mellitus type 2, and inflammatory bowel disease.",
"role": "user"
},
{
"content": "CCCCCC=CCCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a energy source that impacts cardiovascular disease, renal cell carcinoma, and celiac disease. It has an effect on breast cancer, and impacts heart failure, inflammatory bowel disease, and diabetes mellitus type 2.",
"role": "user"
},
{
"content": "CCCCCC=CCCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a energy source that affects breast cancer by impacting heart failure, inflammatory bowel disease, and diabetes mellitus type 2. It impacts celiac disease, cardiovascular disease, and renal cell carcinoma.",
"role": "user"
},
{
"content": "CCCCCC=CCCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "It impacts non-alcoholic fatty liver disease, barth syndrome, and diabetic heart disease. The molecule is a stabilizing mitochondrial structure, a stabilizing cytochrome oxidase, and a proton trap for oxidative phosphorylation. The molecule is a apoptosis and a cholesterol translocation, impacting both tangier disease and aging. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts diabetic heart disease, aging, and tangier disease. The molecule is a stabilizing mitochondrial structure, apoptosis, stabilizing cytochrome oxidase that impacts barth syndrome and non-alcoholic fatty liver disease. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation, impacting both tangier disease and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, apoptosis, proton trap for oxidative phosphorylation that impacts barth syndrome and diabetic heart disease. It impacts aging.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a proton trap for oxidative phosphorylation and a apoptosis that impacts diabetic heart disease, non-alcoholic fatty liver disease, and aging. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation that impacts tangier disease and barth syndrome.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a cholesterol translocation and a apoptosis that impacts diabetic heart disease, barth syndrome, and aging. The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease and tangier disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a stabilizing cytochrome oxidase and cholesterol translocation, and it impacts diabetic heart disease. The molecule is a stabilizing mitochondrial structure and a apoptosis, impacting both tangier disease and aging. The molecule is a proton trap for oxidative phosphorylation that impacts both non-alcoholic fatty liver disease and barth syndrome.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts tangier disease, aging, and barth syndrome. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, apoptosis that impacts diabetic heart disease and non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts diabetic heart disease, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, apoptosis that impacts aging and tangier disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is a stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation, apoptosis that impacts non-alcoholic fatty liver disease and barth syndrome. The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts diabetic heart disease, aging, and tangier disease. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: It impacts barth syndrome. The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure, impacting both tangier disease and non-alcoholic fatty liver disease. The molecule is a apoptosis, cholesterol translocation, proton trap for oxidative phosphorylation that impacts aging and diabetic heart disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a cholesterol translocation that impacts both tangier disease and barth syndrome. The molecule is a stabilizing cytochrome oxidase and a apoptosis, impacting both non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a proton trap for oxidative phosphorylation and stabilizing mitochondrial structure, and it impacts aging.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts aging, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation that impacts tangier disease and diabetic heart disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a apoptosis, cholesterol translocation, stabilizing mitochondrial structure that impacts tangier disease, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation, impacting both barth syndrome and aging.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a proton trap for oxidative phosphorylation that impacts both non-alcoholic fatty liver disease and diabetic heart disease. It impacts aging, barth syndrome, and tangier disease. The molecule is a apoptosis, cholesterol translocation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a stabilizing mitochondrial structure, a stabilizing cytochrome oxidase, and a proton trap for oxidative phosphorylation, and it impacts aging. The molecule is a apoptosis that impacts diabetic heart disease, barth syndrome, and non-alcoholic fatty liver disease. The molecule is a cholesterol translocation that impacts tangier disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a stabilizing mitochondrial structure, apoptosis, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, barth syndrome, and aging. The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation, impacting both tangier disease and diabetic heart disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is both a proton trap for oxidative phosphorylation and a cholesterol translocation. The molecule is a stabilizing cytochrome oxidase and a apoptosis, impacting both tangier disease and barth syndrome. The molecule is a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, diabetic heart disease, and aging.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is a apoptosis that impacts non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure, impacting both aging and diabetic heart disease. The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation, impacting both tangier disease and barth syndrome. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation that impacts both diabetic heart disease and aging. The molecule is a stabilizing mitochondrial structure and apoptosis, and it impacts barth syndrome. The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase, impacting both non-alcoholic fatty liver disease and tangier disease. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a stabilizing mitochondrial structure and a apoptosis, impacting both tangier disease and barth syndrome. The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase, impacting both non-alcoholic fatty liver disease and aging. The molecule is a cholesterol translocation that impacts diabetic heart disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is anti bacterial.",
"role": "user"
},
{
"content": "CCSc1c(C)[nH]c2c(Br)cc(F)c(F)c12",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a anti bacterial. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CCSc1c(C)[nH]c2c(Br)cc(F)c(F)c12",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? It belongs to the anti bacterial class of molecules.",
"role": "user"
},
{
"content": "CCSc1c(C)[nH]c2c(Br)cc(F)c(F)c12",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: It belongs to the anti bacterial class of molecules.",
"role": "user"
},
{
"content": "CCSc1c(C)[nH]c2c(Br)cc(F)c(F)c12",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a anti bacterial.",
"role": "user"
},
{
"content": "CCSc1c(C)[nH]c2c(Br)cc(F)c(F)c12",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a nutrient that impacts both cervical cancer and ulcerative colitis. It impacts both breast cancer and atherosclerosis.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC=CCC=CC=CC(O)CCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a nutrient that impacts breast cancer, cervical cancer, atherosclerosis, and ulcerative colitis.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC=CCC=CC=CC(O)CCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is a nutrient that affects cervical cancer by impacting atherosclerosis, breast cancer, and ulcerative colitis. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC=CCC=CC=CC(O)CCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): It impacts atherosclerosis. The molecule is a nutrient that affects breast cancer by impacting both cervical cancer and ulcerative colitis.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC=CCC=CC=CC(O)CCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a nutrient that affects both cervical cancer and breast cancer, and also impacts ulcerative colitis and atherosclerosis.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC=CCC=CCC=CC=CC(O)CCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, tangier disease, and diabetic heart disease. The molecule is a apoptosis, stabilizing mitochondrial structure, cholesterol translocation that impacts aging and barth syndrome. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a apoptosis and a cholesterol translocation that impacts aging, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, stabilizing mitochondrial structure that impacts tangier disease and barth syndrome.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a stabilizing mitochondrial structure, cholesterol translocation, proton trap for oxidative phosphorylation that impacts tangier disease, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is a apoptosis and a stabilizing cytochrome oxidase, impacting both aging and barth syndrome.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a proton trap for oxidative phosphorylation and a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, aging, and tangier disease. The molecule is a apoptosis, stabilizing mitochondrial structure, cholesterol translocation that impacts diabetic heart disease and barth syndrome.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a proton trap for oxidative phosphorylation, a apoptosis, and a stabilizing mitochondrial structure. The molecule is a cholesterol translocation that impacts both tangier disease and barth syndrome. The molecule is a stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease, aging, and diabetic heart disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a energy storage, nutrient, membrane stabilizer, energy source.",
"role": "user"
},
{
"content": "CCC(CCCC(=O)O)C(=O)O",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is a nutrient, energy storage, membrane stabilizer, energy source. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CCC(CCCC(=O)O)C(=O)O",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is both a energy source and a nutrient. The molecule is both a membrane stabilizer and a energy storage.",
"role": "user"
},
{
"content": "CCC(CCCC(=O)O)C(=O)O",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a energy source, membrane stabilizer, energy storage, nutrient.",
"role": "user"
},
{
"content": "CCC(CCCC(=O)O)C(=O)O",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a nutrient, energy source, membrane stabilizer, energy storage.",
"role": "user"
},
{
"content": "CCC(CCCC(=O)O)C(=O)O",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a thyroxine treatment. The molecule is a fat storage and a nutrient that impacts cardiovascular disease, atherosclerosis, pancreatitis, and metabolic syndrome. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CCCCC=CCCCCCCCC(=O)OCC(COCCCCCCCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a fat storage and thyroxine treatment, and it impacts atherosclerosis. The molecule is a nutrient that impacts cardiovascular disease, pancreatitis, and metabolic syndrome. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CCCCC=CCCCCCCCC(=O)OCC(COCCCCCCCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a fat storage. The molecule is a thyroxine treatment and a nutrient that impacts pancreatitis, atherosclerosis, cardiovascular disease, and metabolic syndrome.",
"role": "user"
},
{
"content": "CCCCC=CCCCCCCCC(=O)OCC(COCCCCCCCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: It impacts both cardiovascular disease and pancreatitis. The molecule is a nutrient, thyroxine treatment, fat storage that impacts atherosclerosis and metabolic syndrome.",
"role": "user"
},
{
"content": "CCCCC=CCCCCCCCC(=O)OCC(COCCCCCCCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is a fat storage and a nutrient that impacts metabolic syndrome, atherosclerosis, pancreatitis, and cardiovascular disease. The molecule is a thyroxine treatment. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "CCCCC=CCCCCCCCC(=O)OCC(COCCCCCCCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a thrombin inhibitor and belongs to the thrombosis treatment class of molecules.",
"role": "user"
},
{
"content": "COC(=O)Cc1cn(-c2cc(C)ccn2)cn1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a thrombin inhibitor that impacts thrombosis treatment.",
"role": "user"
},
{
"content": "COC(=O)Cc1cn(-c2cc(C)ccn2)cn1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a thrombin inhibitor and belongs to the thrombosis treatment class of molecules.",
"role": "user"
},
{
"content": "COC(=O)Cc1cn(-c2cc(C)ccn2)cn1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is a thrombin inhibitor that impacts thrombosis treatment. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "COC(=O)Cc1cn(-c2cc(C)ccn2)cn1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a thrombin inhibitor and is thrombosis treatment.",
"role": "user"
},
{
"content": "COC(=O)Cc1cn(-c2cc(C)ccn2)cn1",
"role": "assistant"
}
] |