id
int64 0
71k
| molecules
dict | messages
listlengths 3
3
| ground_truth
stringclasses 1
value |
---|---|---|---|
100 | {
"selfies": [
"[F][C][=C][C][=C][Branch2][Ring2][=Branch2][C][=C][N][Branch2][Ring1][=C][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=N][Ring2][Ring1][Branch2][N][=C][Ring2][Ring1][=C]",
"[F][C][=C][C][=C][Branch1][Branch2][C][=C][NH1][C][=N][Ring1][Branch1][N][=C][Ring1][O]"
],
"smiles": [
"Fc1ccc(-c2cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cn2)nc1",
"Fc1ccc(-c2c[nH]cn2)nc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be C1CCOC1 .",
"role": "assistant"
}
] | |
101 | {
"selfies": [
"[C][C][O][C][C][N][Ring1][=Branch1]",
"[C][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][C][=Branch1][C][=O][Cl]",
"[C][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][C][=Branch1][C][=O][N][C][C][O][C][C][Ring1][=Branch1]"
],
"smiles": [
"C1COCCN1",
"Cc1ccc(F)cc1C(=O)Cl",
"Cc1ccc(F)cc1C(=O)N1CCOCC1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> From the provided chemical reaction, propose some possible solvents that could have been used.",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
102 | {
"selfies": [
"[C][C][N][Branch1][Ring1][C][C][C][=N][C][=C][Branch2][Ring1][C][C][Branch1][N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][=N][Ring1][=N][C][C][C][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][Ring2][Ring1][#Branch1]",
"[C][C][N][Branch1][Ring1][C][C][C][=N][C][=C][Branch2][Ring1][C][C][Branch1][N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][=N][Ring1][=N][C][C][C][N][C][Ring1][S]"
],
"smiles": [
"CCN(CC)c1nc2c(c(-c3ccc(F)cc3)n1)CCCN(C(=O)OC(C)(C)C)C2",
"CCN(CC)c1nc2c(c(-c3ccc(F)cc3)n1)CCCNC2"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "C1COCCO1.CCOC(C)=O .",
"role": "assistant"
}
] | |
103 | {
"selfies": [
"[C][C][N][Branch1][Ring1][C][C][C][Branch2][Branch1][#Branch2][C][C][O][C][=C][C][=C][Branch2][Ring2][O][C][=Branch1][C][=O][N][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Branch2][Ring1][Ring2][N][Branch1][=Branch1][C][Branch1][C][C][=O][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][C][Ring2][Ring1][Branch1][C][C][=C][Ring2][Ring1][=C][C][=Branch1][C][=O][O][C]",
"[C][C][N][Branch1][Ring1][C][C][C][Branch2][Branch1][#Branch2][C][C][O][C][=C][C][=C][Branch2][Ring2][O][C][=Branch1][C][=O][N][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Branch2][Ring1][Ring2][N][Branch1][=Branch1][C][Branch1][C][C][=O][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][C][Ring2][Ring1][Branch1][C][C][=C][Ring2][Ring1][=C][C][=Branch1][C][=O][O]"
],
"smiles": [
"CCN(CC)C(CCOc1ccc(C(=O)N2c3ccccc3C(N(C(C)=O)c3ccc(Cl)cc3)CC2C)cc1)C(=O)OC",
"CCN(CC)C(CCOc1ccc(C(=O)N2c3ccccc3C(N(C(C)=O)c3ccc(Cl)cc3)CC2C)cc1)C(=O)O"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "C1CCOC1.CO .",
"role": "assistant"
}
] | |
104 | {
"selfies": [
"[O][=C][C][=C][C][=C][C][Branch1][C][O][=C][Ring1][#Branch1]",
"[O][=N+1][Branch1][C][O-1][C][=C][C][Branch1][C][Cl][=C][C][=C][Ring1][#Branch1][Br]",
"[O][=C][C][=C][C][=C][C][Branch2][Ring1][C][O][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][N+1][=Branch1][C][=O][O-1][=C][Ring1][P]"
],
"smiles": [
"O=Cc1cccc(O)c1",
"O=[N+]([O-])c1cc(Cl)ccc1Br",
"O=Cc1cccc(Oc2ccc(Cl)cc2[N+](=O)[O-])c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "CN(C)C=O .",
"role": "assistant"
}
] | |
105 | {
"selfies": [
"[Br][C][C][C][C][Ring1][Ring1]",
"[O][=C][NH1][C][=C][C][Branch1][C][F][=C][Branch1][C][F][C][=C][Ring1][Branch2][C][=Branch1][C][=O][N][Ring1][=N][N][Branch1][#Branch2][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[O][=C][C][=C][C][Branch1][C][F][=C][Branch1][C][F][C][=C][Ring1][Branch2][N][Branch1][#Branch1][C][C][C][C][Ring1][Ring1][C][=Branch1][C][=O][N][Ring1][P][N][Branch1][#Branch2][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"BrCC1CC1",
"O=c1[nH]c2cc(F)c(F)cc2c(=O)n1N(Cc1ccccc1)Cc1ccccc1",
"O=c1c2cc(F)c(F)cc2n(CC2CC2)c(=O)n1N(Cc1ccccc1)Cc1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "What solvents could have been utilized in the following chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CN(C)C=O .",
"role": "assistant"
}
] | |
106 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][C][Branch1][C][N][C][Ring1][#Branch1]",
"[C][C][=C][C][=C][N+1][Branch1][C][O-1][=C][Ring1][#Branch1][Cl]",
"[C][C][=C][C][=C][N+1][Branch1][C][O-1][=C][Ring1][#Branch1][N][C][C][C][C][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][Ring1][=N]"
],
"smiles": [
"CC(C)(C)OC(=O)N1CCCC(N)C1",
"Cc1ccc[n+]([O-])c1Cl",
"Cc1ccc[n+]([O-])c1NC1CCCN(C(=O)OC(C)(C)C)C1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be CCCCO .",
"role": "assistant"
}
] | |
107 | {
"selfies": [
"[N][C][=N][C][Branch1][=Branch2][C][=C][C][=C][N][=C][Ring1][=Branch1][=C][Branch1][#Branch2][C][=C][C][=N][C][=C][Ring1][=Branch1][Cl][C][=C][Ring2][Ring1][Ring1][N+1][=Branch1][C][=O][O-1]",
"[N][C][=C][C][Branch1][#Branch2][C][=C][C][=N][C][=C][Ring1][=Branch1][Cl][=C][Branch1][=Branch2][C][=C][C][=C][N][=C][Ring1][=Branch1][N][=C][Ring2][Ring1][Ring1][N]"
],
"smiles": [
"Nc1nc(-c2cccnc2)c(-c2ccncc2Cl)cc1[N+](=O)[O-]",
"Nc1cc(-c2ccncc2Cl)c(-c2cccnc2)nc1N"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: CCO .",
"role": "assistant"
}
] | |
108 | {
"selfies": [
"[F][C][=C][C][=C][Branch1][=C][S][C][C][C][O][C][C][C][C][C][O][Ring1][=Branch1][C][Branch1][C][F][=C][Ring2][Ring1][C]",
"[O][C][C][C][S][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][F]"
],
"smiles": [
"Fc1ccc(SCCCOC2CCCCO2)c(F)c1",
"OCCCSc1ccc(F)cc1F"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "CO .",
"role": "assistant"
}
] | |
109 | {
"selfies": [
"[C][C][N][C][=C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][=Branch1][C][=O][C][=C][C][=C][C][Branch1][C][F][=C][Branch1][C][Cl][C][=C][Ring1][Branch2][N][=C][Ring1][N][Ring2][Ring1][Ring2]",
"[F][C][=C][C][=C][Branch1][=Branch2][N][C][C][N][C][C][Ring1][=Branch1][C][=C][Ring1][N]",
"[C][C][N][C][=C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][=Branch1][C][=O][C][=C][C][=C][C][Branch1][C][F][=C][Branch2][Ring1][=Branch1][N][C][C][N][Branch1][N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][C][C][Ring1][=N][C][=C][Ring2][Ring1][Ring2][N][=C][Ring2][Ring1][Branch2][Ring2][Ring1][S]"
],
"smiles": [
"CCn1cc(C(=O)O)c(=O)c2cc3cc(F)c(Cl)cc3nc21",
"Fc1ccc(N2CCNCC2)cc1",
"CCn1cc(C(=O)O)c(=O)c2cc3cc(F)c(N4CCN(c5ccc(F)cc5)CC4)cc3nc21"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "c1ccncc1 .",
"role": "assistant"
}
] | |
110 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][O][C][=C][C][=C][C][Branch1][#Branch1][N][C][Branch1][C][C][=O][=C][Ring1][#Branch2]",
"[C][C][=Branch1][C][=O][N][C][=C][C][=C][C][Branch1][#C][O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][O][=C][Ring1][S]"
],
"smiles": [
"COC(=O)c1ccccc1Oc1cccc(NC(C)=O)c1",
"CC(=O)Nc1cccc(Oc2ccccc2C(=O)O)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be C1COCCO1 .",
"role": "assistant"
}
] | |
111 | {
"selfies": [
"[C][C][=Branch2][Ring1][=Branch1][=C][C][=C][N][=C][N][=C][Branch1][C][N][N][=C][Branch1][C][N][C][Ring1][Branch2][=C][Ring1][N][C][=C][C][=C][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][=C][Ring1][=N]",
"[C][C][=Branch2][Ring1][=Branch1][=C][C][=C][N][=C][N][=C][Branch1][C][N][N][=C][Branch1][C][N][C][Ring1][Branch2][=C][Ring1][N][C][=C][C][=C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][=C][Ring1][=Branch2]"
],
"smiles": [
"CC(=Cc1cnc2nc(N)nc(N)c2c1)c1ccc(C(=O)OC(C)(C)C)cc1",
"CC(=Cc1cnc2nc(N)nc(N)c2c1)c1ccc(C(=O)O)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please provide possible solvents based on the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "C[N+](=O)[O-] .",
"role": "assistant"
}
] | |
112 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][C][=N][C][Branch2][Ring2][C][C][=C][C][=C][C][Branch2][Ring1][Branch1][N][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][Branch1][C][F][=C][C][=C][Ring1][#Branch1][F][=C][Ring2][Ring1][C][F][=C][Branch1][N][C][=C][C][=N][C][Branch1][C][Cl][=N][Ring1][#Branch1][S][Ring2][Ring1][#C]",
"[N][C][C][N][C][C][C][C][Ring1][Branch1][=O]",
"[C][C][Branch1][C][C][Branch1][C][C][C][=N][C][Branch2][Ring2][C][C][=C][C][=C][C][Branch2][Ring1][Branch1][N][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][Branch1][C][F][=C][C][=C][Ring1][#Branch1][F][=C][Ring2][Ring1][C][F][=C][Branch2][Ring1][=Branch1][C][=C][C][=N][C][Branch1][N][N][C][C][N][C][C][C][C][Ring1][Branch1][=O][=N][Ring1][#C][S][Ring2][Ring2][#Branch1]"
],
"smiles": [
"CC(C)(C)c1nc(-c2cccc(NS(=O)(=O)c3cc(F)ccc3F)c2F)c(-c2ccnc(Cl)n2)s1",
"NCCN1CCCC1=O",
"CC(C)(C)c1nc(-c2cccc(NS(=O)(=O)c3cc(F)ccc3F)c2F)c(-c2ccnc(NCCN3CCCC3=O)n2)s1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Based on the given chemical reaction, can you propose some likely solvents that might have been utilized?",
"role": "user"
},
{
"content": "A possible solvent can be CO.ClCCl .",
"role": "assistant"
}
] | |
113 | {
"selfies": [
"[C][C][=C][C][=C][C][Branch1][=Branch2][S][=Branch1][C][=O][=Branch1][C][=O][Cl][=C][Ring1][#Branch2]",
"[O][=C][C][C][C][=Branch1][C][=O][N][Ring1][=Branch1][Br]",
"[O][=S][=Branch1][C][=O][Branch1][C][Cl][C][=C][C][=C][C][Branch1][Ring1][C][Br][=C][Ring1][Branch2]"
],
"smiles": [
"Cc1cccc(S(=O)(=O)Cl)c1",
"O=C1CCC(=O)N1Br",
"O=S(=O)(Cl)c1cccc(CBr)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be ClC(Cl)(Cl)Cl .",
"role": "assistant"
}
] | |
114 | {
"selfies": [
"[C][C][Branch1][C][C][O][B][Branch1][#C][C][=C][C][Branch1][C][N][=C][C][Branch1][C][F][=C][Ring1][Branch2][O][C][Ring1][=C][Branch1][C][C][C]",
"[C][O][C][C][S][=Branch1][C][=O][=Branch1][C][=O][Cl]",
"[C][O][C][C][S][=Branch1][C][=O][=Branch1][C][=O][N][C][=C][C][Branch1][C][F][=C][C][Branch2][Ring1][Ring2][B][O][C][Branch1][C][C][Branch1][C][C][C][Branch1][C][C][Branch1][C][C][O][Ring1][=Branch2][=C][Ring1][S]"
],
"smiles": [
"CC1(C)OB(c2cc(N)cc(F)c2)OC1(C)C",
"COCCS(=O)(=O)Cl",
"COCCS(=O)(=O)Nc1cc(F)cc(B2OC(C)(C)C(C)(C)O2)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "c1ccncc1 .",
"role": "assistant"
}
] | |
115 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][N][Branch1][S][C][C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][C][Branch1][C][Cl][=C][Ring1][O]",
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][C][C][N][Branch1][Ring2][C][C][O][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][C][Branch1][C][Cl][=C][Ring1][O]"
],
"smiles": [
"COC(=O)CN(CCC(=O)OC(C)(C)C)c1ccc(C(F)(F)F)c(Cl)c1",
"CC(C)(C)OC(=O)CCN(CCO)c1ccc(C(F)(F)F)c(Cl)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "CO .",
"role": "assistant"
}
] | |
116 | {
"selfies": [
"[C][C][I]",
"[C][C][=N][C][Branch1][P][N][C][C][C][Branch1][#Branch1][C][C][=Branch1][C][=O][O][C][C][Ring1][#Branch2][=C][S][C][Branch1][C][C][=C][Branch1][S][C][=C][Branch1][C][C][C][=C][Branch1][C][Br][C][=C][Ring1][Branch2][C][C][Ring1][#C][=N][Ring2][Ring1][=N]",
"[C][C][O][C][=Branch1][C][=O][C][C][C][C][N][Branch2][Ring2][=Branch1][C][=N][C][Branch1][C][C][=N][C][C][Branch1][S][C][=C][Branch1][C][C][C][=C][Branch1][C][Br][C][=C][Ring1][Branch2][C][=C][Branch1][C][C][S][C][Ring2][Ring1][Ring2][=Ring1][#C][C][C][Ring2][Ring1][#Branch2]"
],
"smiles": [
"CCI",
"Cc1nc(N2CCC(CC(=O)O)CC2)c2sc(C)c(-c3c(C)cc(Br)cc3C)c2n1",
"CCOC(=O)CC1CCN(c2nc(C)nc3c(-c4c(C)cc(Br)cc4C)c(C)sc23)CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please provide possible solvents based on the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "CCOC(C)=O.CN(C)C=O .",
"role": "assistant"
}
] | |
117 | {
"selfies": [
"[C][C][=Branch1][C][=O][O]",
"[C][C][O][C][=Branch1][C][=O][C][=C][C][=C][Branch1][C][N][C][=C][C][=C][Ring1][#Branch1][N][Ring1][#Branch2][C]",
"[C][C][O][C][=Branch1][C][=O][C][=C][C][=C][Branch1][#Branch1][N][C][Branch1][C][C][=O][C][=C][C][=C][Ring1][#Branch2][N][Ring1][=N][C]"
],
"smiles": [
"CC(=O)O",
"CCOC(=O)c1cc2c(N)cccc2n1C",
"CCOC(=O)c1cc2c(NC(C)=O)cccc2n1C"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Based on the given chemical reaction, can you propose some likely solvents that might have been utilized?",
"role": "user"
},
{
"content": "A possible solvent can be c1ccncc1 .",
"role": "assistant"
}
] | |
118 | {
"selfies": [
"[C][O][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][C][C][N][=C][Branch2][Ring1][#Branch2][C][O][N][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Ring1][O][C][Branch1][C][F][Branch1][C][F][F][O][C][=Ring2][Ring1][Ring2][Ring2][Ring1][=Branch2]",
"[O][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][C][C][N][=C][Branch2][Ring1][#Branch2][C][O][N][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Ring1][O][C][Branch1][C][F][Branch1][C][F][F][O][C][=Ring2][Ring1][Ring2][Ring2][Ring1][=Branch2]"
],
"smiles": [
"COc1ccc2c(c1)CCc1nc(-c3onc(-c4ccccc4)c3C(F)(F)F)oc1-2",
"Oc1ccc2c(c1)CCc1nc(-c3onc(-c4ccccc4)c3C(F)(F)F)oc1-2"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> Based on the given chemical reaction, can you propose some likely solvents that might have been utilized?",
"role": "user"
},
{
"content": "A possible solvent can be ClCCl .",
"role": "assistant"
}
] | |
119 | {
"selfies": [
"[C][C][I]",
"[O][=C][Branch1][C][O][C][=C][C][=C][C][Branch1][C][F][=C][C][Branch1][C][Br][=C][Ring1][Branch2][O][Ring1][O]",
"[C][C][O][C][=Branch1][C][=O][C][=C][C][=C][C][Branch1][C][F][=C][C][Branch1][C][Br][=C][Ring1][Branch2][O][Ring1][O]"
],
"smiles": [
"CCI",
"O=C(O)c1cc2cc(F)cc(Br)c2o1",
"CCOC(=O)c1cc2cc(F)cc(Br)c2o1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CN(C)C=O .",
"role": "assistant"
}
] | |
120 | {
"selfies": [
"[Br][C][Branch1][C][Br][Branch1][C][Br][Br]",
"[O][C][C][C][C][C][C][=C][C][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring1][N]",
"[Br][C][C][C][C][C][C][=C][C][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring1][N]"
],
"smiles": [
"BrC(Br)(Br)Br",
"OCCCCCc1ccc(-c2ccccc2)cc1",
"BrCCCCCc1ccc(-c2ccccc2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be ClCCl .",
"role": "assistant"
}
] | |
121 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][=C][C][Branch2][Ring2][Branch1][C][C][C][C][N][Branch2][Ring1][=Branch2][C][=Branch1][C][=O][O][C][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][#Branch2][C][Ring2][Ring1][Ring2][=C][C][=C][Ring2][Ring1][#Branch2][C]",
"[C][C][=C][C][=C][Branch2][Ring2][Branch1][C][C][C][C][N][Branch2][Ring1][=Branch2][C][=Branch1][C][=O][O][C][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][#Branch2][C][Ring2][Ring1][Ring2][C][=C][Ring2][Ring1][#Branch2][C][=Branch1][C][=O][O]"
],
"smiles": [
"CCOC(=O)c1cc(C2CCCN(C(=O)OCc3ccc(C(F)(F)F)cc3)C2)ccc1C",
"Cc1ccc(C2CCCN(C(=O)OCc3ccc(C(F)(F)F)cc3)C2)cc1C(=O)O"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> Based on the given chemical reaction, can you propose some likely solvents that might have been utilized?",
"role": "user"
},
{
"content": "A possible solvent can be O .",
"role": "assistant"
}
] | |
122 | {
"selfies": [
"[O][=N+1][Branch1][C][O-1][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][O][C][Branch1][Ring1][C][O][C][O][Ring1][=Branch2]",
"[N][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][O][C][Branch1][Ring1][C][O][C][O][Ring1][=Branch2]"
],
"smiles": [
"O=[N+]([O-])c1ccc2c(c1)OC(CO)CO2",
"Nc1ccc2c(c1)OC(CO)CO2"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be CO .",
"role": "assistant"
}
] | |
123 | {
"selfies": [
"[C][N][Branch1][C][C][C][=C][C][Branch1][P][C][=C][C][=C][N][=C][Branch1][C][N][S][C][Ring1][=Branch1][=C][Ring1][#Branch2][=C][N][=C][Ring1][S][Cl]",
"[C][O][C][C][=Branch1][C][=O][Cl]",
"[C][O][C][C][=Branch1][C][=O][N][C][=N][C][=C][C][=C][Branch2][Ring1][Ring1][C][=C][N][=C][Branch1][C][Cl][C][Branch1][=Branch1][N][Branch1][C][C][C][=C][Ring1][#Branch2][C][=C][Ring1][S][S][Ring2][Ring1][Ring1]"
],
"smiles": [
"CN(C)c1cc(-c2ccc3nc(N)sc3c2)cnc1Cl",
"COCC(=O)Cl",
"COCC(=O)Nc1nc2ccc(-c3cnc(Cl)c(N(C)C)c3)cc2s1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be ClCCl.c1ccncc1 .",
"role": "assistant"
}
] | |
124 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][Branch1][O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring1][N]",
"[N][C][C][C][Branch1][O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring1][N]"
],
"smiles": [
"CC(C)(C)OC(=O)NC1CC(OCc2ccccc2)C1",
"NC1CC(OCc2ccccc2)C1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
125 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][C][=Branch1][C][=O][Cl]",
"[N][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1]",
"[C][C][Branch1][C][C][Branch1][C][C][C][=Branch1][C][=O][N][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1]"
],
"smiles": [
"CC(C)(C)C(=O)Cl",
"Nc1ccc(Cl)cc1",
"CC(C)(C)C(=O)Nc1ccc(Cl)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "What solvents could have been utilized in the following chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "COC(C)(C)C .",
"role": "assistant"
}
] | |
126 | {
"selfies": [
"[Cl][C][=C][C][=C][C][=C][NH1][C][Ring1][Branch1][=C][Ring1][=Branch2]",
"[Cl][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][N][C][C][Ring1][=Branch1]"
],
"smiles": [
"Clc1ccc2cc[nH]c2c1",
"Clc1ccc2c(c1)NCC2"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "CC(=O)O.CCOC(C)=O .",
"role": "assistant"
}
] | |
127 | {
"selfies": [
"[C][C][Branch1][C][C][N][C][C][S][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1]",
"[O][=C][Branch1][C][Cl][O][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[C][C][Branch1][C][C][N][Branch1][#C][C][C][S][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][=Branch1][C][=O][O][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"CC(C)NCCSc1ccc(Cl)cc1",
"O=C(Cl)Oc1ccccc1",
"CC(C)N(CCSc1ccc(Cl)cc1)C(=O)Oc1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> From the provided chemical reaction, propose some possible solvents that could have been used.",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
128 | {
"selfies": [
"[C][O][C][C][C][C][C][N][Ring1][Branch1]",
"[Cl][C][=C][N][=C][C][Branch1][C][Cl][=N][Ring1][#Branch1]",
"[C][O][C][C][C][C][C][N][Ring1][Branch1][C][=C][N][=C][C][Branch1][C][Cl][=N][Ring1][#Branch1]"
],
"smiles": [
"COCC1CCCN1",
"Clc1cncc(Cl)n1",
"COCC1CCCN1c1cncc(Cl)n1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "CC(=O)N(C)C .",
"role": "assistant"
}
] | |
129 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][C][C][=C][C][=C][Branch2][Ring1][S][O][C][=C][C][=C][Branch2][Ring1][Ring2][C][=Branch1][C][=O][N][C][=C][C][=C][Branch1][C][Cl][C][Branch1][C][Cl][=C][Ring1][Branch2][C][=C][Ring1][P][C][Branch1][O][C][N][S][Branch1][C][C][=Branch1][C][=O][=O][=C][Ring2][Ring1][=C]",
"[C][S][=Branch1][C][=O][=Branch1][C][=O][N][C][C][=C][C][Branch1][#Branch1][C][C][=Branch1][C][=O][O][=C][C][=C][Ring1][#Branch2][O][C][=C][C][=C][Branch2][Ring1][Ring2][C][=Branch1][C][=O][N][C][=C][C][=C][Branch1][C][Cl][C][Branch1][C][Cl][=C][Ring1][Branch2][C][=C][Ring1][P]"
],
"smiles": [
"CC(C)(C)OC(=O)Cc1ccc(Oc2ccc(C(=O)Nc3ccc(Cl)c(Cl)c3)cc2)c(CNS(C)(=O)=O)c1",
"CS(=O)(=O)NCc1cc(CC(=O)O)ccc1Oc1ccc(C(=O)Nc2ccc(Cl)c(Cl)c2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
130 | {
"selfies": [
"[O][=C][Branch1][C][O][C][=C][C][=C][C][=C][Ring1][=Branch1][N][C][=C][C][=C][Branch2][Ring1][Ring1][C][C][C][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][=Branch2][C][=C][Ring2][Ring1][C]",
"[N][C][=C][C][=C][Branch2][Ring1][N][C][C][C][C][=C][C][=C][Branch1][#C][N][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][O][C][=C][Ring1][S][C][=C][Ring2][Ring1][=Branch2]"
],
"smiles": [
"O=C(O)c1ccccc1Nc1ccc(CCCc2ccc([N+](=O)[O-])cc2)cc1",
"Nc1ccc(CCCc2ccc(Nc3ccccc3C(=O)O)cc2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "CC#N.CN(C)C=O .",
"role": "assistant"
}
] | |
131 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][=C][C][=C][Branch2][=Branch1][=N][O][C][C][O][C][=C][Branch2][Ring1][Ring1][C][=C][C][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][#Branch2][C][=C][Branch2][Ring1][=Branch1][C][=Branch1][C][=O][N][C][C][C][C][C][C][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring2][Ring1][P][C][=C][C][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][#Branch2][C][=C][Ring2][Branch1][Branch1][O]",
"[O][=C][Branch2][Ring1][C][N][C][C][C][C][C][C][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][Branch2][Ring1][Ring1][C][=C][C][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][#Branch2][=C][Branch2][Ring1][#Branch1][O][C][C][O][C][=C][C][=C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][Branch1][C][O][=C][Ring1][#Branch2][C][Branch2][Ring1][Ring1][C][=C][C][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][#Branch2][=C][Ring2][Ring2][Branch2]"
],
"smiles": [
"COC(=O)c1ccc(OCCOc2c(-c3cccc(C(F)(F)F)c3)cc(C(=O)NCCCCCCCCc3ccccc3)cc2-c2cccc(C(F)(F)F)c2)cc1O",
"O=C(NCCCCCCCCc1ccccc1)c1cc(-c2cccc(C(F)(F)F)c2)c(OCCOc2ccc(C(=O)O)c(O)c2)c(-c2cccc(C(F)(F)F)c2)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "CCO.O .",
"role": "assistant"
}
] | |
132 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][=C][C][Branch1][Ring1][C][#N][=C][C][=C][Ring1][Branch2][I]",
"[N][#C][C][=C][C][=C][Branch1][C][I][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][Ring1][#Branch2]"
],
"smiles": [
"COC(=O)c1cc(C#N)ccc1I",
"N#Cc1ccc(I)c(C(=O)O)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "What solvents could have been utilized in the following chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CO.O .",
"role": "assistant"
}
] | |
133 | {
"selfies": [
"[C][C][Branch1][C][C][N][C][=Branch1][C][=O][C][=C][C][=C][C][Branch2][Branch1][#Branch1][C][=C][N][=C][C][=Branch1][Ring2][=N][Ring1][=Branch1][C][Branch2][Ring1][Branch2][C][=Branch1][C][=O][N][C][Branch1][C][C][C][=Branch1][C][=O][N][C][C][Branch1][Ring1][C][#N][C][Ring1][=Branch1][=C][N][Ring2][Ring1][Ring1][C][O][C][C][Si][Branch1][C][C][Branch1][C][C][C][=C][Ring2][Ring2][Ring2]",
"[C][C][Branch1][C][C][N][C][=Branch1][C][=O][C][=C][C][=C][C][Branch2][Ring2][#Branch2][C][=C][N][=C][NH1][C][=C][Branch2][Ring1][Branch2][C][=Branch1][C][=O][N][C][Branch1][C][C][C][=Branch1][C][=O][N][C][C][Branch1][Ring1][C][#N][C][Ring1][=Branch1][C][Ring2][Ring1][C][=N][Ring2][Ring1][=Branch1][=C][Ring2][Ring1][N]"
],
"smiles": [
"CC(C)NC(=O)c1cccc(-c2cnc3c(n2)c(C(=O)NC(C)C(=O)N2CC(C#N)C2)cn3COCC[Si](C)(C)C)c1",
"CC(C)NC(=O)c1cccc(-c2cnc3[nH]cc(C(=O)NC(C)C(=O)N4CC(C#N)C4)c3n2)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please provide possible solvents based on the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
134 | {
"selfies": [
"[N][#C][C][=C][C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][=C][Branch1][C][N][C][=C][Ring1][#Branch2][F]",
"[C][=C][NH1][C][=N][Ring1][Branch1]",
"[N][#C][C][=C][C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][=C][Branch1][C][N][C][=C][Ring1][#Branch2][N][C][=C][N][=C][Ring1][Branch1]"
],
"smiles": [
"N#Cc1cc([N+](=O)[O-])c(N)cc1F",
"c1c[nH]cn1",
"N#Cc1cc([N+](=O)[O-])c(N)cc1-n1ccnc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CN(C)C=O.O .",
"role": "assistant"
}
] | |
135 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][=Branch1][Branch2][=N][O][C][Branch1][C][C][C][C][=C][S][C][Branch1][C][N][=N][Ring1][=Branch1]",
"[C][C][Branch1][C][C][O][N][=C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][=C][S][C][Branch1][C][N][=N][Ring1][=Branch1]"
],
"smiles": [
"CCOC(=O)C(=NOC(C)C)c1csc(N)n1",
"CC(C)ON=C(C(=O)O)c1csc(N)n1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> Based on the given chemical reaction, can you propose some likely solvents that might have been utilized?",
"role": "user"
},
{
"content": "A possible solvent can be C1CCOC1 .",
"role": "assistant"
}
] | |
136 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][Branch1][C][O][Branch1][Ring1][C][#N][C][C][Ring1][=Branch2]",
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][Branch1][C][O][Branch1][Ring1][C][N][C][C][Ring1][=Branch2]"
],
"smiles": [
"CC(C)(C)OC(=O)N1CCC(O)(C#N)CC1",
"CC(C)(C)OC(=O)N1CCC(O)(CN)CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please provide possible solvents based on the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "C1CCOC1 .",
"role": "assistant"
}
] | |
137 | {
"selfies": [
"[C][C][Branch1][=C][O][C][=C][C][=C][Branch1][Ring1][C][#N][C][=N][Ring1][Branch2][C][C][N][Branch2][Ring1][N][C][=Branch1][C][=O][C][C][C][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][C][Ring1][=N][C][C][Ring2][Ring1][Ring2][C][=C][C][=C][Branch1][C][Cl][C][Branch1][C][Cl][=C][Ring1][Branch2]",
"[C][C][Branch1][=C][O][C][=C][C][=C][Branch1][Ring1][C][#N][C][=N][Ring1][Branch2][C][C][N][Branch1][=N][C][=Branch1][C][=O][C][C][C][N][C][C][Ring1][=Branch1][C][C][Ring1][=N][C][=C][C][=C][Branch1][C][Cl][C][Branch1][C][Cl][=C][Ring1][Branch2]"
],
"smiles": [
"CC(Oc1ccc(C#N)cn1)C1CN(C(=O)C2CCN(C(=O)OC(C)(C)C)CC2)CC1c1ccc(Cl)c(Cl)c1",
"CC(Oc1ccc(C#N)cn1)C1CN(C(=O)C2CCNCC2)CC1c1ccc(Cl)c(Cl)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
138 | {
"selfies": [
"[C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][O][C][Branch1][Ring1][C][O][C][O][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[C][C][=C][C][=C][Branch1][=Branch2][S][=Branch1][C][=O][=Branch1][C][=O][Cl][C][=C][Ring1][#Branch2]",
"[C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][O][C][Branch2][Ring1][S][C][O][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][C][O][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][C][C][C][=C][Ring1][#Branch1]"
],
"smiles": [
"CCCCCCCCCCCCCCCCCCOC(CO)COC(c1ccccc1)(c1ccccc1)c1ccccc1",
"Cc1ccc(S(=O)(=O)Cl)cc1",
"CCCCCCCCCCCCCCCCCCOC(COC(c1ccccc1)(c1ccccc1)c1ccccc1)COS(=O)(=O)c1ccc(C)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "O .",
"role": "assistant"
}
] | |
139 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][C][=N][N][Branch2][Ring1][#Branch2][C][C][C][C][=Branch1][C][=O][N][Branch1][=N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][F][C][Ring1][=C][C][=Ring2][Ring1][Ring2]",
"[O][=C][Branch1][C][O][C][C][=N][N][Branch2][Ring1][#Branch2][C][C][C][C][=Branch1][C][=O][N][Branch1][=N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][F][C][Ring1][=C][C][=Ring2][Ring1][Ring2]"
],
"smiles": [
"CCOC(=O)c1cnn(CC2CC(=O)N(c3ccc(F)cc3F)C2)c1",
"O=C(O)c1cnn(CC2CC(=O)N(c3ccc(F)cc3F)C2)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> From the provided chemical reaction, propose some possible solvents that could have been used.",
"role": "user"
},
{
"content": "CO.O .",
"role": "assistant"
}
] | |
140 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][=C][C][=C][Branch1][=N][C][=C][C][=C][C][Branch1][Ring1][C][=O][=C][Ring1][Branch2][C][=C][Ring1][=C]",
"[C][O][C][=Branch1][C][=O][C][=C][C][=C][Branch1][=N][C][=C][C][=C][C][Branch1][Ring1][C][O][=C][Ring1][Branch2][C][=C][Ring1][=C]"
],
"smiles": [
"COC(=O)c1ccc(-c2cccc(C=O)c2)cc1",
"COC(=O)c1ccc(-c2cccc(CO)c2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please provide possible solvents based on the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "CCO .",
"role": "assistant"
}
] | |
141 | {
"selfies": [
"[C][C][=N][O][C][=C][C][Branch1][C][O][=C][C][=C][Ring1][#Branch2][Ring1][#Branch1]",
"[N][#C][C][=C][C][Branch1][C][F][=C][C][=C][Ring1][#Branch1][F]",
"[C][C][=N][O][C][=C][C][Branch1][#C][O][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][C][#N][=C][C][=C][Ring2][Ring1][Ring1][Ring1][S]"
],
"smiles": [
"Cc1noc2cc(O)ccc12",
"N#Cc1cc(F)ccc1F",
"Cc1noc2cc(Oc3ccc(F)cc3C#N)ccc12"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "CC(=O)N(C)C.CCOC(C)=O .",
"role": "assistant"
}
] | |
142 | {
"selfies": [
"[C][C][C][C][C][C][C][C][O][C][=Branch1][C][=O][N][C][C][Branch1][O][O][C][=Branch1][C][=O][N][Branch1][C][C][C][C][C][Ring1][O][C][C][Cl]",
"[C][O][C][=C][C][=C][Branch1][O][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Branch1][C][O][=C][Ring1][#C]",
"[C][C][C][C][C][C][C][C][O][C][=Branch1][C][=O][N][C][C][Branch1][O][O][C][=Branch1][C][=O][N][Branch1][C][C][C][C][C][Ring1][O][C][C][O][C][=C][C][Branch1][Ring1][O][C][=C][C][=C][Ring1][Branch2][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"CCCCCCCCOC(=O)N1CC(OC(=O)N(C)C)CC1CCCl",
"COc1ccc(CCc2ccccc2)c(O)c1",
"CCCCCCCCOC(=O)N1CC(OC(=O)N(C)C)CC1CCOc1cc(OC)ccc1CCc1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be CC(=O)N(C)C .",
"role": "assistant"
}
] | |
143 | {
"selfies": [
"[Br][C][=C][C][=C][C][=C][C][=C][Branch2][Ring1][Ring1][C][=C][C][=C][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][Ring1][N][C][=C][C][=C][C][=C][Ring2][Ring1][#Branch2][C][Ring2][Ring1][Branch2][=C][Ring1][=Branch1][Ring2][Ring1][=Branch1]",
"[C][C][Branch1][C][C][O][B][Branch2][Ring1][Ring2][B][O][C][Branch1][C][C][Branch1][C][C][C][Branch1][C][C][Branch1][C][C][O][Ring1][=Branch2][O][C][Ring1][#C][Branch1][C][C][C]",
"[C][C][Branch1][C][C][O][B][Branch2][Ring2][P][C][=C][C][=C][C][=C][C][=C][Branch2][Ring1][Ring1][C][=C][C][=C][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][Ring1][N][C][=C][C][=C][C][=C][Ring2][Ring1][#Branch2][C][Ring2][Ring1][Branch2][=C][Ring1][=Branch1][Ring2][Ring1][=Branch1][O][C][Ring2][Ring2][C][Branch1][C][C][C]"
],
"smiles": [
"Brc1ccc2ccc3c(-c4cccc(-c5ccccc5)c4)ccc4ccc1c2c43",
"CC1(C)OB(B2OC(C)(C)C(C)(C)O2)OC1(C)C",
"CC1(C)OB(c2ccc3ccc4c(-c5cccc(-c6ccccc6)c5)ccc5ccc2c3c54)OC1(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: C1COCCO1 .",
"role": "assistant"
}
] | |
144 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][O][C][=C][C][=C][C][=C][Ring1][=Branch1][N+1][=Branch1][C][=O][O-1]",
"[C][C][Branch1][C][C][Branch1][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][O][C][=C][C][=C][C][=C][Ring1][=Branch1][N]"
],
"smiles": [
"CC(C)(C)c1ccccc1Oc1ccccc1[N+](=O)[O-]",
"CC(C)(C)c1ccccc1Oc1ccccc1N"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "C1CCOC1.CO .",
"role": "assistant"
}
] | |
145 | {
"selfies": [
"[C][O][C][C][=N][C][Branch1][C][C][=C][Branch2][Ring1][Branch1][C][=C][C][Branch1][#Branch1][C][=Branch1][C][=O][O][C][=C][Branch1][C][C][C][=C][Ring1][O][C][NH1][Ring2][Ring1][C]",
"[C][O][C][C][=N][C][Branch1][C][C][=C][Branch2][Ring1][Ring2][C][=C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][Branch1][C][C][C][=C][Ring1][#Branch2][C][NH1][Ring1][P]"
],
"smiles": [
"COCc1nc(C)c(-c2cc(C(=O)OC)c(C)cc2C)[nH]1",
"COCc1nc(C)c(-c2cc(C(=O)O)c(C)cc2C)[nH]1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be CO.O .",
"role": "assistant"
}
] | |
146 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][N][C][C][C][Branch2][Ring1][#Branch1][C][C][C][O][C][=C][C][=C][Branch1][=Branch2][C][=N][C][C][C][O][Ring1][=Branch1][C][=C][Ring1][N][C][C][Ring2][Ring1][=Branch1]",
"[C][=C][C][Branch1][=Branch2][C][=N][C][C][C][O][Ring1][=Branch1][=C][C][=C][Ring1][N][O][C][C][C][C][C][C][N][C][C][Ring1][=Branch1]"
],
"smiles": [
"CCOC(=O)N1CCC(CCCOc2ccc(C3=NCCCO3)cc2)CC1",
"c1cc(C2=NCCCO2)ccc1OCCCC1CCNCC1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CC(C)O .",
"role": "assistant"
}
] | |
147 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][O][C][Branch2][Ring2][Ring1][C][=Branch1][C][=O][N][C][C][N][Branch2][Ring1][Ring2][C][=Branch1][C][=O][N][C][=C][C][=C][Branch1][C][Cl][C][Branch1][C][Cl][=C][Ring1][Branch2][C][C][Ring1][P][C][Ring2][Ring1][=Branch2]",
"[O][=C][Branch1][S][N][C][=C][C][=C][Branch1][C][Cl][C][Branch1][C][Cl][=C][Ring1][Branch2][N][C][C][N][Branch1][=N][C][=Branch1][C][=O][C][C][N][C][C][O][Ring1][=Branch1][C][C][Ring1][=C]"
],
"smiles": [
"CC(C)(C)OC(=O)N1CCOC(C(=O)N2CCN(C(=O)Nc3ccc(Cl)c(Cl)c3)CC2)C1",
"O=C(Nc1ccc(Cl)c(Cl)c1)N1CCN(C(=O)C2CNCCO2)CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "ClCCl.O=C(O)C(F)(F)F .",
"role": "assistant"
}
] | |
148 | {
"selfies": [
"[Cl][C][C][C][Br]",
"[I][C][C][=N][NH1][C][=Ring1][Branch1]",
"[Cl][C][C][C][N][C][=C][Branch1][C][I][C][=N][Ring1][=Branch1]"
],
"smiles": [
"ClCCCBr",
"Ic1cn[nH]c1",
"ClCCCn1cc(I)cn1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "CN(C)C=O .",
"role": "assistant"
}
] | |
149 | {
"selfies": [
"[O][=N+1][Branch1][C][O-1][C][=C][C][=C][C][=C][Branch1][C][Cl][N][=C][C][=C][Ring1][O][Ring1][#Branch1]",
"[N][C][=C][C][=C][C][=C][Branch1][C][Cl][N][=C][C][=C][Ring1][O][Ring1][#Branch1]"
],
"smiles": [
"O=[N+]([O-])c1cccc2c(Cl)nccc12",
"Nc1cccc2c(Cl)nccc12"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "CCOC(C)=O .",
"role": "assistant"
}
] | |
150 | {
"selfies": [
"[O][=C][C][C][Branch2][Ring1][S][C][O][C][C][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][C][N][Ring2][Ring1][=C]",
"[F][C][Branch1][C][F][Branch1][C][F][C][=C][C][Branch2][Ring1][#Branch1][C][O][C][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][C][N][C][C][Ring1][=N][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring2][Ring1][#Branch2]"
],
"smiles": [
"O=C1CC(COCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2ccccc2)CCCN1",
"FC(F)(F)c1cc(COCC2(c3ccccc3)CCCNCC2)cc(C(F)(F)F)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "CCOCC .",
"role": "assistant"
}
] | |
151 | {
"selfies": [
"[C][C][C][C][C][=C][Branch1][S][C][=C][C][=C][Ring1][=Branch1][O][C][=C][C][=C][C][=C][Ring1][=Branch1][N][Ring1][P]",
"[O][=C][C][C][C][=Branch1][C][=O][N][Ring1][=Branch1][Br]",
"[C][C][C][C][C][=C][Branch2][Ring1][Ring1][C][=C][C][Branch1][C][Br][=C][Ring1][#Branch1][O][C][=C][C][=C][C][=C][Ring1][=Branch1][N][Ring2][Ring1][C]"
],
"smiles": [
"CC1CCc2c(cccc2Oc2ccccc2)N1",
"O=C1CCC(=O)N1Br",
"CC1CCc2c(ccc(Br)c2Oc2ccccc2)N1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CC#N .",
"role": "assistant"
}
] | |
152 | {
"selfies": [
"[C][C][Branch1][C][C][O][B][Branch2][Ring1][Ring2][B][O][C][Branch1][C][C][Branch1][C][C][C][Branch1][C][C][Branch1][C][C][O][Ring1][=Branch2][O][C][Ring1][#C][Branch1][C][C][C]",
"[N][C][=N][N][=C][Branch1][#C][C][=C][C][Branch1][C][O][=C][C][Branch1][C][Br][=C][Ring1][Branch2][O][Ring1][=N]",
"[C][C][Branch1][C][C][O][B][Branch2][Ring1][Branch2][C][=C][C][Branch1][C][O][=C][C][Branch1][O][C][=N][N][=C][Branch1][C][N][O][Ring1][=Branch1][=C][Ring1][=N][O][C][Ring2][Ring1][Ring1][Branch1][C][C][C]"
],
"smiles": [
"CC1(C)OB(B2OC(C)(C)C(C)(C)O2)OC1(C)C",
"Nc1nnc(-c2cc(O)cc(Br)c2)o1",
"CC1(C)OB(c2cc(O)cc(-c3nnc(N)o3)c2)OC1(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "What solvents could have been utilized in the following chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "C1COCCO1 .",
"role": "assistant"
}
] | |
153 | {
"selfies": [
"[C][I]",
"[C][O][C][=C][C][Branch1][Ring1][C][N][=C][C][=Branch2][Ring1][Ring1][=C][Ring1][Branch2][C][C][=Branch1][C][=O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][S][C][=C][Branch2][Ring1][Branch2][C][=C][C][Branch1][Ring1][O][C][=C][Ring1][Branch2][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][N][Ring2][Ring1][#C][C][=Branch1][C][=O][C][C][C][C][=Branch1][C][=O][O]",
"[C][O][C][=Branch1][C][=O][C][C][C][C][=Branch1][C][=O][N][C][=C][C][=C][Branch1][Ring1][O][C][C][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][=C][Ring1][#C][S][C][=C][Branch1][S][C][C][=Branch1][C][=O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Branch1][Ring1][O][C][=C][C][Branch1][Ring1][C][N][=C][Ring2][Ring1][Branch1][Ring2][Ring2][=Branch1]"
],
"smiles": [
"CI",
"COc1cc(CN)c2c(c1CC(=O)OCc1ccccc1)Sc1c(ccc(OC)c1C(=O)OC(C)(C)C)N2C(=O)CCCC(=O)O",
"COC(=O)CCCC(=O)N1c2ccc(OC)c(C(=O)OC(C)(C)C)c2Sc2c(CC(=O)OCc3ccccc3)c(OC)cc(CN)c21"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "CCOC(C)=O.CN(C)C=O .",
"role": "assistant"
}
] | |
154 | {
"selfies": [
"[C][=C][C][=C][Branch2][Ring1][#Branch2][C][N][C][C][C][C][Branch1][#C][N][C][=C][C][=C][NH1][N][=C][C][Ring1][Branch1][=C][Ring1][=Branch2][C][Ring1][S][C][=C][Ring2][Ring1][#Branch1]",
"[C][=C][C][NH1][N][=C][C][=Ring1][Branch1][C][=C][Ring1][=Branch2][N][C][C][C][C][N][C][Ring1][=Branch1]"
],
"smiles": [
"c1ccc(CN2CCCC(Nc3ccc4[nH]ncc4c3)C2)cc1",
"c1cc2[nH]ncc2cc1NC1CCCNC1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "CCO .",
"role": "assistant"
}
] | |
155 | {
"selfies": [
"[C][C][N][C][C][N][Ring1][=Branch1]",
"[N][C][=N][C][Branch2][Ring1][Ring2][N][C][=C][C][=C][Branch1][=Branch2][N][C][C][O][C][C][Ring1][=Branch1][C][=C][Ring1][N][=N][N][Ring2][Ring1][C][C][=C][C][Branch1][C][Cl][=N][C][=N][Ring1][#Branch1]",
"[N][C][=N][C][Branch2][Ring1][Ring2][N][C][=C][C][=C][Branch1][=Branch2][N][C][C][O][C][C][Ring1][=Branch1][C][=C][Ring1][N][=N][N][Ring2][Ring1][C][C][=C][C][Branch1][=Branch2][N][C][C][N][C][C][Ring1][=Branch1][=N][C][=N][Ring1][N]"
],
"smiles": [
"C1CNCCN1",
"Nc1nc(Nc2ccc(N3CCOCC3)cc2)nn1-c1cc(Cl)ncn1",
"Nc1nc(Nc2ccc(N3CCOCC3)cc2)nn1-c1cc(N2CCNCC2)ncn1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "C1CCOC1 .",
"role": "assistant"
}
] | |
156 | {
"selfies": [
"[C][C][=C][C][Branch1][C][F][=C][C][=C][Ring1][#Branch1][N+1][=Branch1][C][=O][O-1]",
"[N][C][C][C][C][C][O]",
"[C][C][=C][C][Branch1][Branch2][N][C][C][C][C][C][O][=C][C][=C][Ring1][=N][N+1][=Branch1][C][=O][O-1]"
],
"smiles": [
"Cc1cc(F)ccc1[N+](=O)[O-]",
"NCCCCCO",
"Cc1cc(NCCCCCO)ccc1[N+](=O)[O-]"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "O .",
"role": "assistant"
}
] | |
157 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][=C][Branch1][=Branch1][C][O][C][C][O][N][C][Branch1][C][C][=C][Branch1][#Branch1][C][=Branch1][C][=O][O][C][C][Ring1][S][C][=C][C][=C][C][=C][Ring1][=Branch1][Cl]",
"[Cl][C][=N][C][=C][C][=N][Ring1][=Branch1]",
"[C][C][O][C][=Branch1][C][=O][C][=C][Branch1][=C][C][O][C][C][O][C][=N][C][=C][C][=N][Ring1][=Branch1][N][C][Branch1][C][C][=C][Branch1][#Branch1][C][=Branch1][C][=O][O][C][C][Ring2][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][Cl]"
],
"smiles": [
"CCOC(=O)C1=C(COCCO)NC(C)=C(C(=O)OC)C1c1ccccc1Cl",
"Clc1ncccn1",
"CCOC(=O)C1=C(COCCOc2ncccn2)NC(C)=C(C(=O)OC)C1c1ccccc1Cl"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "C1CCOC1 .",
"role": "assistant"
}
] | |
158 | {
"selfies": [
"[C][C][=C][C][=C][Branch2][Ring1][Ring1][C][C][O][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][=Branch2][N][=C][Ring2][Ring1][C]",
"[C][C][=C][C][=C][Branch1][#C][C][C][O][C][=C][C][=C][Branch1][C][N][C][=C][Ring1][#Branch1][N][=C][Ring1][S]"
],
"smiles": [
"Cc1ccc(CCOc2ccc([N+](=O)[O-])cc2)nc1",
"Cc1ccc(CCOc2ccc(N)cc2)nc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "CO .",
"role": "assistant"
}
] | |
159 | {
"selfies": [
"[N][C][=C][C][Branch1][=N][C][=Branch1][C][=O][N][C][C][O][C][C][Ring1][=Branch1][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring2][Ring1][C]",
"[N][C][=C][C][Branch1][#Branch2][C][N][C][C][O][C][C][Ring1][=Branch1][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][P]"
],
"smiles": [
"Nc1cc(C(=O)N2CCOCC2)cc(C(F)(F)F)c1",
"Nc1cc(CN2CCOCC2)cc(C(F)(F)F)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please provide possible solvents based on the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "C1CCOC1 .",
"role": "assistant"
}
] | |
160 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][=N][C][=C][Branch1][C][C][C][Branch1][Ring1][O][C][=C][Ring1][=Branch2][C]",
"[C][O][C][=C][Branch1][C][C][C][=N][C][Branch1][Ring1][C][O][=C][Ring1][=Branch2][C]"
],
"smiles": [
"COC(=O)c1ncc(C)c(OC)c1C",
"COc1c(C)cnc(CO)c1C"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> From the provided chemical reaction, propose some possible solvents that could have been used.",
"role": "user"
},
{
"content": "C1CCOC1 .",
"role": "assistant"
}
] | |
161 | {
"selfies": [
"[C][N][C][C][N][C][C][Ring1][=Branch1]",
"[O][=C][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][Branch1][C][Cl][=C][Ring1][#Branch2]",
"[C][N][C][C][N][Branch2][Ring1][Ring2][C][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][Branch1][C][Cl][=C][Ring1][#Branch2][C][C][Ring1][P]"
],
"smiles": [
"CN1CCNCC1",
"O=Cc1ccc([N+](=O)[O-])c(Cl)c1",
"CN1CCN(Cc2ccc([N+](=O)[O-])c(Cl)c2)CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Based on the given chemical reaction, can you propose some likely solvents that might have been utilized?",
"role": "user"
},
{
"content": "A possible solvent can be Cc1ccccc1 .",
"role": "assistant"
}
] | |
162 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][C][N][Branch2][Ring1][Ring2][C][C][=C][C][=C][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][Ring1][N][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][C][C][Branch1][C][C][Branch1][C][C][O][Ring1][=Branch2]",
"[C][C][Branch1][C][C][C][C][C][=C][C][Branch2][Ring2][Ring2][S][=Branch1][C][=O][=Branch1][C][=O][N][Branch1][#Branch1][C][C][=Branch1][C][=O][O][C][C][=C][C][=C][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][Ring1][N][=C][C][=C][Ring2][Ring1][O][O][Ring2][Ring1][S]"
],
"smiles": [
"CC(C)(C)OC(=O)CN(Cc1cccc(-c2ccccc2)c1)S(=O)(=O)c1ccc2c(c1)CCC(C)(C)O2",
"CC1(C)CCc2cc(S(=O)(=O)N(CC(=O)O)Cc3cccc(-c4ccccc4)c3)ccc2O1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
163 | {
"selfies": [
"[O][=N+1][Branch1][C][O-1][C][=C][C][=C][C][Branch1][C][O][=C][Ring1][#Branch1]",
"[O][C][C][Br]",
"[O][=N+1][Branch1][C][O-1][C][=C][C][=C][C][Branch1][Branch1][O][C][C][O][=C][Ring1][#Branch2]"
],
"smiles": [
"O=[N+]([O-])c1cccc(O)c1",
"OCCBr",
"O=[N+]([O-])c1cccc(OCCO)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be CC#N .",
"role": "assistant"
}
] | |
164 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][=C][C][=C][C][Branch2][Ring1][=Branch2][C][=C][C][C][Branch1][#C][N][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][C][Ring1][=C][=C][Ring2][Ring1][Ring2]",
"[C][C][O][C][=Branch1][C][=O][C][=C][C][=C][C][Branch1][N][C][=C][C][C][Branch1][C][N][C][C][Ring1][#Branch1][=C][Ring1][=N]"
],
"smiles": [
"CCOC(=O)c1cccc(C2=CCC(NC(=O)OC(C)(C)C)CC2)c1",
"CCOC(=O)c1cccc(C2=CCC(N)CC2)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: C1COCCO1.Cl .",
"role": "assistant"
}
] | |
165 | {
"selfies": [
"[Br][Br]",
"[C][C][=C][C][=C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][Branch1][C][O][=C][Ring1][#Branch2]",
"[C][C][=C][C][Branch1][C][O][=C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][=C][Ring1][#Branch2][Br]"
],
"smiles": [
"BrBr",
"Cc1ccc(C(=O)O)c(O)c1",
"Cc1cc(O)c(C(=O)O)cc1Br"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Based on the given chemical reaction, can you propose some likely solvents that might have been utilized?",
"role": "user"
},
{
"content": "A possible solvent can be CO .",
"role": "assistant"
}
] | |
166 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][=C][N][=C][Branch2][Ring1][Branch1][C][C][C][C][Branch1][=Branch2][C][=C][C][=C][C][=N][Ring1][=Branch1][=N][O][C][=Ring1][O][C][S][Ring2][Ring1][Ring1]",
"[C][C][O][N][=C][Branch1][=Branch2][C][=C][C][=C][C][=N][Ring1][=Branch1][C][=Ring1][O][C][C][C][=N][C][=C][Branch1][=Branch1][C][=Branch1][C][=O][O][S][Ring1][Branch2]"
],
"smiles": [
"COC(=O)c1cnc(CCc2c(-c3ccccn3)noc2C)s1",
"Cc1onc(-c2ccccn2)c1CCc1ncc(C(=O)O)s1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "C1CCOC1.O .",
"role": "assistant"
}
] | |
167 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][Branch1][Branch2][C][C][C][C][C][Ring1][Ring2][C][=C][C][Branch1][O][O][C][C][Branch1][C][F][Branch1][C][F][F][=C][Branch1][C][Cl][C][Branch2][Ring1][Ring1][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][#Branch2][=C][Ring2][Ring1][#Branch1]",
"[O][=C][Branch1][C][O][C][Branch1][Branch2][C][C][C][C][C][Ring1][Ring2][C][=C][C][Branch1][O][O][C][C][Branch1][C][F][Branch1][C][F][F][=C][Branch1][C][Cl][C][Branch2][Ring1][Ring1][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][#Branch2][=C][Ring2][Ring1][#Branch1]"
],
"smiles": [
"COC(=O)C(CC1CCC1)c1cc(OCC(F)(F)F)c(Cl)c(-c2ccc(C(F)(F)F)cc2)c1",
"O=C(O)C(CC1CCC1)c1cc(OCC(F)(F)F)c(Cl)c(-c2ccc(C(F)(F)F)cc2)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please provide possible solvents based on the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "O .",
"role": "assistant"
}
] | |
168 | {
"selfies": [
"[C][C][=C][C][Branch2][Ring1][#C][C][=C][C][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][=C][C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][=C][Ring1][S][=C][C][=N][Ring2][Ring1][=Branch1]",
"[C][C][=C][C][Branch2][Ring1][O][C][=C][C][Branch1][C][N][=C][C][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][=C][Ring1][=C][=C][C][=N][Ring2][Ring1][Ring2]"
],
"smiles": [
"Cc1cc(-c2cc(C(=O)OC(C)(C)C)cc([N+](=O)[O-])c2)ccn1",
"Cc1cc(-c2cc(N)cc(C(=O)OC(C)(C)C)c2)ccn1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be CO .",
"role": "assistant"
}
] | |
169 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][=C][C][=C][Branch1][C][Cl][C][Branch1][#Branch2][C][Branch1][C][C][Branch1][C][C][C][#N][=C][Ring1][N]",
"[C][C][Branch1][C][C][Branch1][Ring1][C][#N][C][=C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][C][=C][Ring1][=Branch2][Cl]"
],
"smiles": [
"COC(=O)c1ccc(Cl)c(C(C)(C)C#N)c1",
"CC(C)(C#N)c1cc(C(=O)O)ccc1Cl"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "C1CCOC1 .",
"role": "assistant"
}
] | |
170 | {
"selfies": [
"[O][=N+1][Branch1][C][O-1][C][=C][C][=C][C][=C][C][=C][Branch2][Ring1][=Branch1][C][=C][C][Branch1][C][F][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][O][N][=C][Ring2][Ring1][Branch1][Ring1][P]",
"[N][C][=C][C][=C][C][=C][C][=C][Branch2][Ring1][=Branch1][C][=C][C][Branch1][C][F][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][O][N][=C][Ring2][Ring1][Branch1][Ring1][P]"
],
"smiles": [
"O=[N+]([O-])c1cccc2ccc(-c3cc(F)cc(C(F)(F)F)c3)nc12",
"Nc1cccc2ccc(-c3cc(F)cc(C(F)(F)F)c3)nc12"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please provide possible solvents based on the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "CC(C)O.O .",
"role": "assistant"
}
] | |
171 | {
"selfies": [
"[O][=S][=Branch1][C][=O][Branch1][C][Cl][C][=C][C][=C][C][=C][Ring1][=Branch1][Cl]",
"[O][C][=C][C][Branch1][C][O][=C][C][=C][C][=C][C][Ring1][=Branch1][=C][Ring1][O]",
"[O][=S][=Branch1][C][=O][Branch2][Ring1][Ring1][O][C][=C][C][Branch1][C][O][=C][C][=C][C][=C][C][Ring1][=Branch1][=C][Ring1][O][C][=C][C][=C][C][=C][Ring1][=Branch1][Cl]"
],
"smiles": [
"O=S(=O)(Cl)c1ccccc1Cl",
"Oc1cc(O)c2ccccc2c1",
"O=S(=O)(Oc1cc(O)c2ccccc2c1)c1ccccc1Cl"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Based on the given chemical reaction, can you propose some likely solvents that might have been utilized?",
"role": "user"
},
{
"content": "A possible solvent can be C1CCOC1 .",
"role": "assistant"
}
] | |
172 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][N][=C][N][Branch2][Ring1][C][C][=Branch1][C][=O][C][=Ring1][#Branch1][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][O][C][Ring1][P][C][C][S][C]",
"[C][S][C][C][C][O][C][C][N][C][Ring1][=Branch1][=N][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][Branch1][O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring1][P][=O]"
],
"smiles": [
"CCOC(=O)c1nc2n(c(=O)c1OCc1ccccc1)CCOC2CCSC",
"CSCCC1OCCn2c1nc(C(=O)O)c(OCc1ccccc1)c2=O"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "C1CCOC1.O .",
"role": "assistant"
}
] | |
173 | {
"selfies": [
"[Br][P][Branch1][C][Br][Br]",
"[O][C][C][=C][C][Branch1][C][Br][=C][C][=C][Ring1][#Branch1][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[Br][C][C][=C][C][Branch1][C][Br][=C][C][=C][Ring1][#Branch1][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"BrP(Br)Br",
"OCc1cc(Br)ccc1OCc1ccccc1",
"BrCc1cc(Br)ccc1OCc1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "CCOCC .",
"role": "assistant"
}
] | |
174 | {
"selfies": [
"[C][C][Branch1][C][C][O][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][Branch2][Ring1][=Branch2][N][C][C][C][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][C][Ring1][=N][=C][Ring2][Ring1][#Branch1]",
"[C][C][Branch1][C][C][O][C][=C][C][=C][Branch1][C][N][C][Branch2][Ring1][=Branch2][N][C][C][C][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][C][Ring1][=N][=C][Ring2][Ring1][Branch1]"
],
"smiles": [
"CC(C)Oc1ccc([N+](=O)[O-])c(NC2CCN(C(=O)OC(C)(C)C)CC2)c1",
"CC(C)Oc1ccc(N)c(NC2CCN(C(=O)OC(C)(C)C)CC2)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CCO .",
"role": "assistant"
}
] | |
175 | {
"selfies": [
"[N][#C][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][C][Branch1][C][F][Branch1][C][F][F]",
"[N][C][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][C][Branch1][C][F][Branch1][C][F][F]"
],
"smiles": [
"N#Cc1ccc(F)cc1C(F)(F)F",
"NCc1ccc(F)cc1C(F)(F)F"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "CCO .",
"role": "assistant"
}
] | |
176 | {
"selfies": [
"[C][C][C][S][=Branch1][C][=O][=Branch1][C][=O][Cl]",
"[C][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][N][C][=C][Branch1][#Branch1][C][=N][N][Ring1][Branch1][C][C][N][Ring1][N][C][=Branch1][C][=O][C][=C][C][=C][Branch1][Ring1][C][N][C][Branch1][C][F][=C][Ring1][=Branch2]",
"[C][C][C][S][=Branch1][C][=O][=Branch1][C][=O][N][C][C][=C][C][=C][Branch2][Ring1][#C][C][=Branch1][C][=O][N][C][C][C][=N][N][Branch1][C][C][C][=Ring1][=Branch1][N][C][=C][C][Branch1][C][C][=C][C][=C][Ring1][#Branch1][Ring1][S][C][=C][Ring2][Ring1][Branch2][F]"
],
"smiles": [
"CCCS(=O)(=O)Cl",
"Cc1ccc2c(c1)Nc1c(cnn1C)CN2C(=O)c1ccc(CN)c(F)c1",
"CCCS(=O)(=O)NCc1ccc(C(=O)N2Cc3cnn(C)c3Nc3cc(C)ccc32)cc1F"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Based on the given chemical reaction, can you propose some likely solvents that might have been utilized?",
"role": "user"
},
{
"content": "A possible solvent can be ClCCl .",
"role": "assistant"
}
] | |
177 | {
"selfies": [
"[N][C][=C][C][Branch1][N][O][C][C][N][C][C][O][C][C][Ring1][=Branch1][=C][C][=C][Ring1][#C][Cl]",
"[O][=C][Branch1][C][Cl][C][=C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[O][=C][Branch1][O][C][=C][C][=C][C][=C][C][=C][Ring1][=Branch1][N][C][=C][C][Branch1][N][O][C][C][N][C][C][O][C][C][Ring1][=Branch1][=C][C][=C][Ring1][#C][Cl]"
],
"smiles": [
"Nc1cc(OCCN2CCOCC2)ccc1Cl",
"O=C(Cl)C=Cc1ccccc1",
"O=C(C=Cc1ccccc1)Nc1cc(OCCN2CCOCC2)ccc1Cl"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "CC(C)=O.O .",
"role": "assistant"
}
] | |
178 | {
"selfies": [
"[C][C][=C][C][=N][C][Branch2][Ring1][=Branch1][N][C][=C][C][=C][Branch1][O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring1][=C][=C][Ring2][Ring1][Branch1][N+1][=Branch1][C][=O][O-1]",
"[C][C][=C][C][=N][C][Branch2][Ring1][=Branch1][N][C][=C][C][=C][Branch1][O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring1][=C][=C][Ring2][Ring1][Branch1][N]"
],
"smiles": [
"Cc1ccnc(Nc2ccc(OCc3ccccc3)cc2)c1[N+](=O)[O-]",
"Cc1ccnc(Nc2ccc(OCc3ccccc3)cc2)c1N"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> From the provided chemical reaction, propose some possible solvents that could have been used.",
"role": "user"
},
{
"content": "C1CCOC1 .",
"role": "assistant"
}
] | |
179 | {
"selfies": [
"[C][=C][C][C][C][=C][C][Branch1][C][F][=C][C][=C][Ring1][#Branch1][C][=O]",
"[N][C][C][C][Ring1][Ring1]",
"[C][=C][C][C][C][=C][C][Branch1][C][F][=C][C][=C][Ring1][#Branch1][C][N][C][C][C][Ring1][Ring1]"
],
"smiles": [
"C=CCCc1cc(F)ccc1C=O",
"NC1CC1",
"C=CCCc1cc(F)ccc1CNC1CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Based on the given chemical reaction, can you propose some likely solvents that might have been utilized?",
"role": "user"
},
{
"content": "A possible solvent can be CO .",
"role": "assistant"
}
] | |
180 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][=C][C][=C][Branch1][#C][C][=C][C][=C][C][Branch1][C][Cl][=C][C][=C][Ring1][#Branch1][N][C][=C][Ring1][S]",
"[O][=S][=Branch1][C][=O][Branch1][C][Cl][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1]",
"[C][O][C][=Branch1][C][=O][C][=C][C][=C][Branch2][Ring1][P][C][=C][C][=C][C][Branch1][C][Cl][=C][C][=C][Ring1][#Branch1][N][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][=C][Ring2][Ring1][#Branch2]"
],
"smiles": [
"COC(=O)c1ccc(C=Cc2cc(Cl)ccc2N)cc1",
"O=S(=O)(Cl)c1ccc(Cl)cc1",
"COC(=O)c1ccc(C=Cc2cc(Cl)ccc2NS(=O)(=O)c2ccc(Cl)cc2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some possible solvents that could have been utilized?",
"role": "user"
},
{
"content": "ClCCl.c1ccncc1 .",
"role": "assistant"
}
] | |
181 | {
"selfies": [
"[C][=C][C][Br]",
"[O][=N+1][Branch1][C][O-1][C][=C][C][=C][Branch1][C][Cl][C][Branch1][C][O][=C][Ring1][Branch2]",
"[C][=C][C][O][C][=C][C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][=C][C][=C][Ring1][=Branch2][Cl]"
],
"smiles": [
"C=CCBr",
"O=[N+]([O-])c1ccc(Cl)c(O)c1",
"C=CCOc1cc([N+](=O)[O-])ccc1Cl"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please provide possible solvents based on the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "O .",
"role": "assistant"
}
] | |
182 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][Si][Branch1][C][Cl][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[O][=C][N][C][C][Branch1][Ring1][C][O][O][Ring1][#Branch1]",
"[C][C][Branch1][C][C][Branch1][C][C][Si][Branch1][=N][O][C][C][C][N][C][=Branch1][C][=O][O][Ring1][=Branch1][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"CC(C)(C)[Si](Cl)(c1ccccc1)c1ccccc1",
"O=C1NCC(CO)O1",
"CC(C)(C)[Si](OCC1CNC(=O)O1)(c1ccccc1)c1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Based on the given chemical reaction, can you propose some likely solvents that might have been utilized?",
"role": "user"
},
{
"content": "A possible solvent can be CN(C)C=O.O .",
"role": "assistant"
}
] | |
183 | {
"selfies": [
"[Br][C][C][C][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[O][=C][C][=C][C][=C][Branch1][C][O][C][=C][Ring1][#Branch1]",
"[O][=C][C][=C][C][=C][Branch1][#C][O][C][C][C][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring2][Ring1][C]"
],
"smiles": [
"BrCCCOCc1ccccc1",
"O=Cc1ccc(O)cc1",
"O=Cc1ccc(OCCCOCc2ccccc2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "CN(C)C=O.O .",
"role": "assistant"
}
] | |
184 | {
"selfies": [
"[C][C][=C][Branch1][C][F][C][=C][C][=C][Ring1][#Branch1][N][C][C][Branch1][C][C][Branch1][C][C][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][C][Ring1][#C][=O]",
"[C][C][=C][Branch1][C][F][C][=C][C][=C][Ring1][#Branch1][N][C][C][Branch1][C][C][Branch1][C][C][N][C][C][Ring1][Branch2][=O]"
],
"smiles": [
"Cc1c(F)cccc1N1CC(C)(C)N(C(=O)OC(C)(C)C)CC1=O",
"Cc1c(F)cccc1N1CC(C)(C)NCC1=O"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please provide possible solvents based on the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
185 | {
"selfies": [
"[N][#C][C][N][C][C][C][C][Branch1][C][O][C][Ring1][#Branch1]",
"[N][C][C][N][C][C][C][C][Branch1][C][O][C][Ring1][#Branch1]"
],
"smiles": [
"N#CCN1CCCC(O)C1",
"NCCN1CCCC(O)C1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be C1CCOC1 .",
"role": "assistant"
}
] | |
186 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][=C][C][Branch1][N][S][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][NH1][Ring1][=C]",
"[O][=C][Branch1][C][O][C][=C][C][Branch1][N][S][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][NH1][Ring1][=C]"
],
"smiles": [
"COC(=O)c1cc(SCCc2ccccc2)c[nH]1",
"O=C(O)c1cc(SCCc2ccccc2)c[nH]1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CO.O .",
"role": "assistant"
}
] | |
187 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][=Branch1][C][=O][C][=C][C][=C][Branch1][P][O][C][C][=C][C][=C][C][=C][C][=C][C][Ring1][=Branch1][=N][Ring1][#Branch2][C][=C][Ring2][Ring1][C]",
"[O][=C][Branch1][C][O][C][=Branch1][C][=O][C][=C][C][=C][Branch1][P][O][C][C][=C][C][=C][C][=C][C][=C][C][Ring1][=Branch1][=N][Ring1][#Branch2][C][=C][Ring2][Ring1][C]"
],
"smiles": [
"COC(=O)C(=O)c1ccc(OCc2ccc3ccccc3n2)cc1",
"O=C(O)C(=O)c1ccc(OCc2ccc3ccccc3n2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> Based on the given chemical reaction, can you propose some likely solvents that might have been utilized?",
"role": "user"
},
{
"content": "A possible solvent can be C1CCOC1.CO .",
"role": "assistant"
}
] | |
188 | {
"selfies": [
"[F][C][=C][C][=C][C][=C][NH1][C][Ring1][Branch1][=C][Ring1][=Branch2]",
"[F][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][N][C][C][Ring1][=Branch1]"
],
"smiles": [
"Fc1ccc2cc[nH]c2c1",
"Fc1ccc2c(c1)NCC2"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: CC(=O)O .",
"role": "assistant"
}
] | |
189 | {
"selfies": [
"[O][=N+1][Branch1][C][O-1][C][=C][C][=C][Branch2][Ring2][S][O][C][C][C][N][Branch2][Ring2][Ring1][C][C][=C][C][=C][Branch2][Ring1][#Branch1][C][Branch1][C][O][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][S][C][C][Ring2][Ring1][#Branch1][C][Branch1][C][Br][=C][Ring2][Ring1][#C]",
"[N][C][=C][C][=C][Branch2][Ring2][S][O][C][C][C][N][Branch2][Ring2][Ring1][C][C][=C][C][=C][Branch2][Ring1][#Branch1][C][Branch1][C][O][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][S][C][C][Ring2][Ring1][#Branch1][C][Branch1][C][Br][=C][Ring2][Ring1][#C]"
],
"smiles": [
"O=[N+]([O-])c1ccc(OC2CCN(Cc3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)CC2)c(Br)c1",
"Nc1ccc(OC2CCN(Cc3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)CC2)c(Br)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be CC(C)O.ClCCl .",
"role": "assistant"
}
] | |
190 | {
"selfies": [
"[C][N][C][C][Branch1][Ring1][C][O][O][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring1][N]",
"[C][S][=Branch1][C][=O][=Branch1][C][=O][Cl]",
"[C][N][C][C][Branch1][O][C][O][S][Branch1][C][C][=Branch1][C][=O][=O][O][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring1][S]"
],
"smiles": [
"CN1CC(CO)Oc2ccccc21",
"CS(=O)(=O)Cl",
"CN1CC(COS(C)(=O)=O)Oc2ccccc21"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
191 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][O][C][C][O]",
"[C][S][=Branch1][C][=O][=Branch1][C][=O][Cl]",
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][O][C][C][O][S][Branch1][C][C][=Branch1][C][=O][=O]"
],
"smiles": [
"CC(C)(C)OC(=O)NCCOCCO",
"CS(=O)(=O)Cl",
"CC(C)(C)OC(=O)NCCOCCOS(C)(=O)=O"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given this chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>, what are some solvents that could have been used?",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] | |
192 | {
"selfies": [
"[C][C][=O]",
"[N-1][=N+1][=N][C][=C][C][=C][Branch1][Ring1][C][=O][C][=C][Ring1][Branch2]",
"[N-1][=N+1][=N][C][=C][C][=C][Branch1][Branch1][C][=C][C][=O][C][=C][Ring1][#Branch2]"
],
"smiles": [
"CC=O",
"[N-]=[N+]=Nc1ccc(C=O)cc1",
"[N-]=[N+]=Nc1ccc(C=CC=O)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please provide possible solvents based on the following chemical reaction <molecule_2d>.<molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "CC(C)O.O .",
"role": "assistant"
}
] | |
193 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][C][C][N][Branch1][#Branch2][C][=Branch1][C][=O][C][Branch1][C][C][C][C][=N][C][Branch1][C][C][=C][O][Ring1][=Branch1]",
"[C][C][=C][O][C][Branch2][Ring1][Branch1][N][Branch1][=Branch2][C][C][C][C][=Branch1][C][=O][O][C][=Branch1][C][=O][C][Branch1][C][C][C][=N][Ring1][P]"
],
"smiles": [
"CCOC(=O)CCCN(C(=O)C(C)C)c1nc(C)co1",
"Cc1coc(N(CCCC(=O)O)C(=O)C(C)C)n1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Please suggest some possible solvents that could have been used in the following chemical reaction <molecule_2d>>><molecule_2d>.",
"role": "user"
},
{
"content": "CCO .",
"role": "assistant"
}
] | |
194 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][C][C][C][=C][C][=C][Branch1][=C][O][C][C][C][N][C][=C][C][=C][C][=N][Ring1][=Branch1][C][=C][Ring1][P][C][N][Branch1][#Branch2][C][C][Branch1][C][F][Branch1][C][F][F][C][Ring2][Ring1][O][=O]",
"[O][=C][Branch1][C][O][C][C][C][C][=C][C][=C][Branch1][=C][O][C][C][C][N][C][=C][C][=C][C][=N][Ring1][=Branch1][C][=C][Ring1][P][C][N][Branch1][#Branch2][C][C][Branch1][C][F][Branch1][C][F][F][C][Ring2][Ring1][O][=O]"
],
"smiles": [
"COC(=O)CC1Cc2ccc(OCCCNc3ccccn3)cc2CN(CC(F)(F)F)C1=O",
"O=C(O)CC1Cc2ccc(OCCCNc3ccccn3)cc2CN(CC(F)(F)F)C1=O"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you suggest some solvents that might have been used in the given chemical reaction? <molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "A probable solvent could be C1COCCO1 .",
"role": "assistant"
}
] | |
195 | {
"selfies": [
"[C][C][C][N][C][C][Ring1][=Branch1]",
"[O][=N+1][Branch1][C][O-1][C][=C][C][=C][Branch1][C][Br][C][=C][Ring1][#Branch1][N][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[O][=N+1][Branch1][C][O-1][C][=C][C][=C][Branch1][=Branch2][N][C][C][C][C][C][Ring1][=Branch1][C][=C][Ring1][N][N][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"C1CCNCC1",
"O=[N+]([O-])c1ccc(Br)cc1Nc1ccccc1",
"O=[N+]([O-])c1ccc(N2CCCCC2)cc1Nc1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: CN1CCCC1=O .",
"role": "assistant"
}
] | |
196 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][=C][C][=C][Branch2][Ring1][Branch1][N][C][=Branch1][C][=O][C][C][Branch1][C][C][Branch1][C][C][C][Ring1][Branch1][Branch1][C][C][C][C][=C][Ring1][S]",
"[C][C][Branch1][C][C][C][Branch2][Ring1][C][C][=Branch1][C][=O][N][C][=C][C][=C][Branch1][Ring1][C][N][C][=C][Ring1][Branch2][C][Ring1][#C][Branch1][C][C][C]"
],
"smiles": [
"CC(C)(C)OC(=O)NCc1ccc(NC(=O)C2C(C)(C)C2(C)C)cc1",
"CC1(C)C(C(=O)Nc2ccc(CN)cc2)C1(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Based on the given chemical reaction <molecule_2d>>><molecule_2d>, suggest some possible solvents.",
"role": "user"
},
{
"content": "The solvent can be C1COCCO1 .",
"role": "assistant"
}
] | |
197 | {
"selfies": [
"[C][C][Branch1][C][C][N]",
"[O][=C][C][C][C][Branch2][Ring1][C][C][=C][C][=C][Branch1][Branch2][O][C][C][C][O][Ring1][Ring1][C][=C][Ring1][O][=N][N][Ring1][P]",
"[C][C][Branch1][C][C][N][C][C][Branch1][C][O][C][O][C][=C][C][=C][Branch1][N][C][=N][N][C][=Branch1][C][=O][C][C][Ring1][#Branch1][C][=C][Ring1][=N]"
],
"smiles": [
"CC(C)N",
"O=C1CCC(c2ccc(OCC3CO3)cc2)=NN1",
"CC(C)NCC(O)COc1ccc(C2=NNC(=O)CC2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "<molecule_2d>.<molecule_2d>>><molecule_2d> Please propose potential solvents that might have been utilized in the provided chemical reaction.",
"role": "user"
},
{
"content": "Sure. A potential answer could be: CO .",
"role": "assistant"
}
] | |
198 | {
"selfies": [
"[C][N][C][Branch2][Ring1][=Branch2][C][O][C][=C][C][=C][Branch1][=N][C][C][S][C][=Branch1][C][=O][N][C][Ring1][=Branch1][=O][C][=C][Ring1][=C][=N][C][=C][C][=C][Branch1][#C][O][C][C][C][=C][C][=C][Branch1][C][N][C][=C][Ring1][#Branch1][C][=C][Ring1][S][Ring2][Ring2][Ring1]",
"[O][=C][=N][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1]",
"[C][N][C][Branch2][Ring1][=Branch2][C][O][C][=C][C][=C][Branch1][=N][C][C][S][C][=Branch1][C][=O][N][C][Ring1][=Branch1][=O][C][=C][Ring1][=C][=N][C][=C][C][=C][Branch2][Ring1][S][O][C][C][C][=C][C][=C][Branch2][Ring1][C][N][C][=Branch1][C][=O][N][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][=C][Ring1][P][C][=C][Ring2][Ring1][#Branch2][Ring2][Ring2][=N]"
],
"smiles": [
"Cn1c(COc2ccc(CC3SC(=O)NC3=O)cc2)nc2ccc(OCCc3ccc(N)cc3)cc21",
"O=C=Nc1ccc(Cl)cc1",
"Cn1c(COc2ccc(CC3SC(=O)NC3=O)cc2)nc2ccc(OCCc3ccc(NC(=O)Nc4ccc(Cl)cc4)cc3)cc21"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Can you provide potential solvents for the following chemical reaction? <molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "CN(C)C=O .",
"role": "assistant"
}
] | |
199 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][N][Branch2][Ring2][#C][C][C][C][O][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][=Branch1][C][=O][C][Branch1][=Branch2][C][=C][C][=C][N][=C][Ring1][=Branch1][=C][Ring1][=N][C][=C][C][Branch1][C][F][=C][C][Branch1][C][F][=C][Ring1][Branch2][C][C][Ring2][Ring2][C]",
"[O][=C][C][Branch1][=Branch2][C][=C][C][=C][N][=C][Ring1][=Branch1][=C][Branch1][#C][C][=C][C][Branch1][C][F][=C][C][Branch1][C][F][=C][Ring1][Branch2][C][=C][C][=C][Branch1][=N][O][C][C][C][N][C][C][N][C][C][Ring1][=Branch1][C][=C][Ring1][S][Ring2][Ring1][P]"
],
"smiles": [
"CC(C)(C)OC(=O)N1CCN(CCCOc2ccc3c(c2)C(=O)C(c2cccnc2)=C3c2cc(F)cc(F)c2)CC1",
"O=C1C(c2cccnc2)=C(c2cc(F)cc(F)c2)c2ccc(OCCCN3CCNCC3)cc21"
]
} | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the possible solvents of the reaction. The reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the solvents. We provide the SMILES of the reactions.",
"role": "system"
},
{
"content": "Given the following chemical reaction <molecule_2d>>><molecule_2d>, what are some potential solvents that could have been employed?",
"role": "user"
},
{
"content": "ClCCl .",
"role": "assistant"
}
] |