smiles
stringlengths 1
82
| iupac
stringlengths 6
67
| calc
float64 -18.16
3.34
| expt
float64 -25.47
3.43
|
|---|---|---|---|
COC(C(F)(F)F)(OC)OC | 1,1,1-trifluoro-2,2,2-trimethoxyethane | -2.319 | -0.8 |
C[C@@H](C(F)(F)F)O | 1,1,1-trifluoropropan-2-ol | -3.518 | -4.16 |
CCC | propane | 2.495 | 2 |
COC(CCl)(OC)OC | 2-chloro-1,1,1-trimethoxy-ethane | -3.638 | -4.59 |
CC(C)COC=O | isobutyl formate | -3.458 | -2.22 |
COS(=O)(=O)C | methyl methanesulfonate | -8.824 | -4.87 |
CCCCCC=O | hexanal | -2.86 | -2.81 |
CCCCCCCC=C | non-1-ene | 2.995 | 2.06 |
CCCC#N | butanenitrile | -2.287 | -3.64 |
CCc1cccc2c1cccc2 | 1-ethylnaphthalene | -2.961 | -2.4 |
C1C=CC=CC=C1 | cyclohepta-1,3,5-triene | -0.098 | -0.99 |
CCCCC#C | hex-1-yne | 0.553 | 0.29 |
CCC#C | but-1-yne | 0.284 | -0.16 |
CNc1ccccc1 | N-methylaniline | -5.719 | -4.69 |
c1cnccc1C#N | pyridine-4-carbonitrile | -5.765 | -6.02 |
C(C(F)(F)F)O | 2,2,2-trifluoroethanol | -3.809 | -4.31 |
C(Cl)(Cl)Cl | chloroform | 0.285 | -1.08 |
C(Br)(Br)Br | bromoform | -0.531 | -2.13 |
CCCCC(=O)OC | methyl pentanoate | -3.492 | -2.56 |
C[C@@H](c1ccc2cc(ccc2c1)OC)C(=O)O | naproxen | -12.199 | -10.21 |
c1cc(c(c(c1)Cl)Cl)Cl | 1,2,3-trichlorobenzene | -0.51 | -1.24 |
C1CCC(=O)CC1 | cyclohexanone | -4.18 | -4.91 |
CCOCCOCC | 1,2-diethoxyethane | -3.42 | -3.54 |
c1ccsc1 | thiophene | -0.359 | -1.4 |
CCCC[N+](=O)[O-] | 1-nitrobutane | -1.449 | -3.09 |
[C@@H](C(F)(F)F)(F)Br | 2-bromo-1,1,1,2-tetrafluoro-ethane | 0.234 | 0.5 |
c1ccc2cc3ccccc3cc2c1 | anthracene | -5.187 | -3.95 |
Cc1ccccn1 | 2-methylpyridine | -3.501 | -4.63 |
CCCOCCC | 1-propoxypropane | -0.004 | -1.16 |
CCCC=C | pent-1-ene | 2.532 | 1.68 |
CC[C@@H](C)CO | 2-methylbutan-1-ol | -2.995 | -4.42 |
c1cc(c(c(c1c2cc(c(c(c2Cl)Cl)Cl)Cl)Cl)Cl)Cl | 1,2,3,4-tetrachloro-5-(2,3,4-trichlorophenyl)benzene | -0.805 | -4.4 |
c1ccc(c(c1)O)I | 2-iodophenol | -3.221 | -6.2 |
c1ccc(cc1)N | aniline | -5.543 | -5.49 |
COCCOC | 1,2-dimethoxyethane | -3.103 | -4.84 |
Cc1c[nH]c2c1cccc2 | 3-methyl-1H-indole | -8.161 | -5.88 |
CCCN | propan-1-amine | -3.053 | -4.39 |
CNC | N-methylmethanamine | -2.991 | -4.29 |
c1ccc(c(c1)Cl)Cl | 1,2-dichlorobenzene | -0.553 | -1.36 |
c1ccc2c(c1)CCC2 | indane | -1.752 | -1.46 |
CN(C)C(=O)c1ccc(cc1)[N+](=O)[O-] | N,N-dimethyl-4-nitro-benzamide | -10.036 | -11.95 |
CCC(C)CC | 3-methylpentane | 2.613 | 2.51 |
C[C@@H](CCl)Cl | 1,2-dichloropropane | -0.265 | -1.27 |
CCCC#C | pent-1-yne | 0.47 | 0.01 |
C(F)(F)(F)F | tetrafluoromethane | 2.489 | 3.12 |
c1ccc(cc1)Cl | chlorobenzene | -0.475 | -1.12 |
CCCCl | 1-chloropropane | 0.973 | -0.33 |
CCCCO | butan-1-ol | -3.232 | -4.72 |
Cc1ccccc1C=O | 2-methylbenzaldehyde | -4.554 | -3.93 |
COP(=O)([C@H](C(Cl)(Cl)Cl)O)OC | (1R)-2,2,2-trichloro-1-dimethoxyphosphoryl-ethanol | -13.424 | -12.74 |
C[C@@H]1CC[C@H](CC1=O)C(=C)C | (2R,5R)-2-methyl-5-(1-methylethenyl)-cyclohexanone | -3.344 | -3.75 |
Cc1cccc(c1)C | m-xylene | -0.697 | -0.83 |
CC=O | acetaldehyde | -3.372 | -3.5 |
COc1cccc(c1)O | 3-methoxyphenol | -6.969 | -7.66 |
Cc1ccc(cc1)C | p-xylene | -0.658 | -0.8 |
C(C(Cl)(Cl)Cl)Cl | 1,1,1,2-tetrachloroethane | -0.091 | -1.43 |
CCCCOCCCC | 1-butoxybutane | 0.139 | -0.83 |
CC(C)C(=O)C | 3-methylbutan-2-one | -3.078 | -3.24 |
CCOP(=S)(OCC)Oc1ccc(cc1)[N+](=O)[O-] | diethoxy-(4-nitrophenoxy)-thioxo-$l^{5}-phosphane | -9.211 | -6.74 |
COc1c(ccc(c1C(=O)O)Cl)Cl | dicamba | -8.658 | -9.86 |
CCN | ethanamine | -3.156 | -4.5 |
c1(c(c(c(c(c1Cl)Cl)Cl)Cl)Cl)Cl | hexachlorobenzene | 0.379 | -2.33 |
c1cc(ccc1O)F | 4-fluorophenol | -4.955 | -6.19 |
c1ccc(cc1)CCCO | 3-phenylpropan-1-ol | -5.771 | -6.92 |
CCCI | 1-iodopropane | -0.443 | -0.53 |
c1ccc(cc1)C=O | benzaldehyde | -5.058 | -4.02 |
CCC(=O)CC | pentan-3-one | -3.05 | -3.41 |
CC(C)C(=O)C(C)C | 2,4-dimethylpentan-3-one | -2.629 | -2.74 |
CC1=CC(=O)CC(C1)(C)C | 3,5,5-trimethylcyclohex-2-en-1-one | -4.088 | -5.18 |
CC(C)(C)Cl | 2-chloro-2-methyl-propane | 0.826 | 1.09 |
CC(=O)N | acetamide | -8.82 | -9.71 |
Cc1cc(cnc1)C | 3,5-dimethylpyridine | -2.869 | -4.84 |
CCC(=O)N | propionamide | -8.31 | -9.4 |
C1CC=CC1 | cyclopentene | 1.23 | 0.56 |
CCCCCCCN | heptan-1-amine | -2.554 | -3.79 |
CC | ethane | 2.465 | 1.83 |
COc1ccc(cc1)C(=O)OC | methyl 4-methoxybenzoate | -6.462 | -5.33 |
CC(C)OC(C)C | 2-isopropoxypropane | -0.178 | -0.53 |
CN(C)C(=O)c1ccc(cc1)OC | 4-methoxy-N,N-dimethyl-benzamide | -9.625 | -11.01 |
C1[C@H]([C@@H]2[C@H]([C@H]1Cl)[C@]3(C(=C([C@@]2(C3(Cl)Cl)Cl)Cl)Cl)Cl)Cl | chlordane | -3.23 | -3.44 |
C[C@H]1CCCO1 | 2-methyltetrahydrofuran | -1.984 | -3.3 |
CCCCCCI | 1-iodohexane | 0.043 | 0.08 |
CI | iodomethane | -0.641 | -0.89 |
CCOC(=O)c1ccc(cc1)O | ethyl paraben | -9.535 | -9.2 |
CCCCCO | pentan-1-ol | -3.054 | -4.57 |
CN(C)C(=O)c1ccccc1 | N,N-dimethylbenzamide | -8.113 | -9.29 |
CC(=O)C | acetone | -3.506 | -3.8 |
c1c(cc(c(c1Cl)Cl)Cl)Cl | 1,2,3,5-tetrachlorobenzene | 0.136 | -1.62 |
C1CCC(C1)O | cyclopentanol | -4.29 | -5.49 |
COc1ccccc1O | 2-methoxyphenol | -4.746 | -5.94 |
C(CCl)Cl | 1,2-dichloroethane | -0.363 | -1.79 |
Cc1ccccc1C | o-xylene | -0.851 | -0.9 |
CCCCCCCCCO | nonan-1-ol | -2.564 | -3.88 |
CCC(C)(C)CC | 3,3-dimethylpentane | 2.593 | 2.56 |
c1ccc(c(c1)C=O)O | 2-hydroxybenzaldehyde | -8.809 | -4.68 |
CN(C)C(=O)Nc1ccccc1 | fenuron | -11.81 | -9.13 |
COc1c(cc(c(c1O)OC)Cl)Cl | 3,5-dichloro-2,6-dimethoxyphenol | -5.98 | -6.44 |
CC(C)CCO | 3-methylbutan-1-ol | -3.237 | -4.42 |
CC(=O)c1ccncc1 | 1-(4-pyridyl)ethanone | -7.566 | -7.62 |
C(CO[N+](=O)[O-])CO[N+](=O)[O-] | 3-nitrooxypropyl nitrate | -5.322 | -4.8 |
End of preview. Expand
in Dataset Viewer.
No dataset card yet
New: Create and edit this dataset card directly on the website!
Contribute a Dataset Card- Downloads last month
- 3